
CAS Number1486-01-7
Synonymsdecadeuterio-biphenyl; d10-biphenyl; 1,1'-Biphenyl-2,2',3,3',4,4',5,5',6,6'-d10; Biphenyl-2,2',3,3',4,4',5,5',6,6'-d10; 1,1'-biphenyl-d10; MFCD00074892; (H)Biphenyl; 1,1'-Biphenyl-d; biphenyl-d9; Diphenyl-d10; Biphenyl-d10
Molecular FormulaC6D5-C6D5
Molecular Weight164.27
Density1.0±0.1 g/cm3
Boiling Point258.0±7.0 °C at 760 mmHg
Melting Point70-72ºC(lit.)
AppearanceColorless crystals with a unique odor
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1486-01-7 |
| Catalog No. | 2A-1191603 |
| Chinese Name | 联苯-d10 |
| Synonyms | decadeuterio-biphenyl; d10-biphenyl; 1,1'-Biphenyl-2,2',3,3',4,4',5,5',6,6'-d10; Biphenyl-2,2',3,3',4,4',5,5',6,6'-d10; 1,1'-biphenyl-d10; MFCD00074892; (H)Biphenyl; 1,1'-Biphenyl-d; biphenyl-d9; Diphenyl-d10; Biphenyl-d10 |
| Molecular Formula | C6D5-C6D5 |
| Molecular Weight | 164.27 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 258.0±7.0 °C at 760 mmHg |
| Melting Point | 70-72ºC(lit.) |
| Appearance | Colorless crystals with a unique odor |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| PubChem ID | 24859820 |
| MDL Number | MFCD00074892 |
| SMILES | c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChI Key | ZUOUZKKEUPVFJK-LHNTUAQVSA-N |
| NACRES Code | NA.12 |
| UNSPSC | 12352005 |
| Transport Info | Product Name: Biphenyl-d₁₀ |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methyl-2-butanone | 563-84-0 | 2A-1191591 |
| 2-METHYL-3-PENTANONE | 566-69-5 | 2A-1191592 |
| N-([1,1'-biphenyl]-2-yl)dibenzo[b,d]thiophen-2-amine | 2170534-12-8 | 2A-1191598 |
| Benzenamine, 4-benzo[b]thien-2-yl- | 54492-95-4 | 2A-1191600 |
| 1-IODO-2-PHENOXY-BENZENE | 34883-46-0 | 2A-1191602 |
| N1,N1'-(biphenyl-4,4'-diyl)bis(N1-phenyl-N4,N4-di-m-tolylbenzene-1,4-diamine) | 199121-98-7 | 2A-1191604 |
| 1,1'-Biphenyl, 2-bromo-4'-(1,1-dimethylethyl)- | 1033692-34-0 | 2A-1191605 |
| METHYL 2,3-DICHLOROBENZOATE | 2905-54-6 | 2A-1191607 |
| 4-CHLORO-1,1':2',1''-terphenyl | 21711-54-6 | 2A-1191608 |
| 4-BROMO-2,3,5,6-TETRAFLUOROBENZOTRIFLUORIDE | 17823-46-0 | 2A-1191609 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA