
CAS Number9029-11-2
SynonymsMFCD00016431; 3-Methylbutyl 3,4,5-trihydroxybenzoate; Benzoic acid, 3,4,5-trihydroxy-, 3-methylbutyl ester; EINECS 219-626-2; R0N2645G7I; Isoamyl Gallate
Molecular FormulaC12H16O5
Molecular Weight240.252
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point450.9±40.0 °C at 760 mmHg
Appearancesolution (viscous) | amber
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 9029-11-2 |
| Catalog No. | 2A-1191232 |
| Chinese Name | L-谷氨酸脱氢酶 |
| Synonyms | MFCD00016431; 3-Methylbutyl 3,4,5-trihydroxybenzoate; Benzoic acid, 3,4,5-trihydroxy-, 3-methylbutyl ester; EINECS 219-626-2; R0N2645G7I; Isoamyl Gallate |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.252 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 450.9±40.0 °C at 760 mmHg |
| Appearance | solution (viscous) | amber |
| Storage Condition | 2-8°C |
| Application | Glutamic acid dehydrogenase (NADP) is a biochemical reagent that can be used as a biological material or organic compound for life science-related research. |
| HTC | 35079090 |
| PubChem ID | 8197379 |
| MDL Number | MFCD00131461 |
| InChI | InChI=1S/C12H16O5/c1-7(2)3-4-17-12(16)8-5-9(13)11(15)10(14)6-8/h5-7,13-15H,3-4H2,1-2H3 |
| InChI Key | YBMTWYWCLVMFFD-UHFFFAOYSA-N |
| NACRES Code | NA.54 |
| UNSPSC | 12352204 |
| Transport Info | Product name: L-glutamate dehydrogenase (NADP type) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2,3-trichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene | 864736-87-8 | 2A-1191270 |
| 5-Bromo-2,3-dihydro-1H-inden-1-amine | 185122-74-1 | 2A-1191272 |
| 4-Isopropoxybenzoylacetonitrile | 884504-22-7 | 2A-1191273 |
| 4-Methylhippuric Acid | 27115-50-0 | 2A-1191274 |
| 4-Chlorobenzyl benzoate | 20386-93-0 | 2A-1191275 |
| 6-BroMonicotiniMidaMide | 1346541-66-9 | 2A-1191279 |
| 2-BroMothiophen-3-aMine | 106944-13-2 | 2A-1191281 |
| 5,12-bis((triisopropylsilyl)ethynyl)tetracene | 628316-50-7 | 2A-1191282 |
| PK 14105 | 107257-28-3 | 2A-1191283 |
| LY2228820 | 862507-23-1 | 2A-1191284 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA