
CAS Number185122-74-1
Synonyms(rac)-5-bromo-indan-1-ylamine; 5-BROMO-INDAN-1-YLAMINE; 5-bromo-1-indanamine; 5-BROMOINDANYLAMINE; 5-bromo-2,3-dihydro-1H-indene-1-amine; 1-amino-5-bromoindane; 5-BROMOINDAN-1-AMINE
Molecular FormulaC9H10BrN
Molecular Weight212.09
Boiling Point278.2 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 185122-74-1 |
| Catalog No. | 2A-1191272 |
| Chinese Name | 5-溴-2,3-二氢-1H-茚-1-胺 |
| Synonyms | (rac)-5-bromo-indan-1-ylamine; 5-BROMO-INDAN-1-YLAMINE; 5-bromo-1-indanamine; 5-BROMOINDANYLAMINE; 5-bromo-2,3-dihydro-1H-indene-1-amine; 1-amino-5-bromoindane; 5-BROMOINDAN-1-AMINE |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 |
| Boiling Point | 278.2 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2921499090 |
| PubChem ID | 38336137 |
| SMILES | NC1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C9H10BrN/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5,9H,1,4,11H2 |
| InChI Key | IEUKCNPRRGOGDG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Oxo-cyclopentanecarbonitrile | 41171-91-9 | 2A-1191262 |
| N-(3-bromo-2-cyanophenyl)-benzenesulfonamide | 1392091-60-9 | 2A-1191263 |
| N-[3-bromo-2-(1H-tetrazol-5-yl)-phenyl]-benzenesulfonamide | 1392091-30-3 | 2A-1191264 |
| METHYL-2-METHOXY-3-NITROBENZOATE | 90564-26-4 | 2A-1191268 |
| 1,2,3-trichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene | 864736-87-8 | 2A-1191270 |
| 4-Isopropoxybenzoylacetonitrile | 884504-22-7 | 2A-1191273 |
| 4-Methylhippuric Acid | 27115-50-0 | 2A-1191274 |
| 4-Chlorobenzyl benzoate | 20386-93-0 | 2A-1191275 |
| Glutamate Dehydrogenase | 9029-11-2 | 2A-1191232 |
| 6-BroMonicotiniMidaMide | 1346541-66-9 | 2A-1191279 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA