
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 395-05-1 |
| Catalog No. | 2A-1190817 |
| Chinese Name | 3-氟扁桃酸 |
| Synonyms | (3-Fluorophenyl)(hydroxy)acetic acid; 3-Fluoromandelic acid |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.14 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 318.6±27.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918199090 |
| PubChem ID | 116053 |
| SMILES | O=C(O)C(O)c1cccc(F)c1 |
| InChI | InChI=1S/C8H7FO3/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7,10H,(H,11,12) |
| InChI Key | HNUJOYMRHWMPOM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucose | 188783-78-0 | 2A-1190805 |
| Methyl 4-(difluoroMethoxy)-3-hydroxybenzoate | 1159429-52-3 | 2A-1190811 |
| 3-(5-HydroxypyriMidin-2-yl)benzoic acid Methyl ester | 1092568-87-0 | 2A-1190813 |
| Benzenamine, 4-ethoxy-N-methyl- | 3154-18-5 | 2A-1190815 |
| 2H-Indazol-6-amine, N,2,3-trimethyl | 1376676-65-1 | 2A-1190816 |
| Geranic acid 85% stabilized | 459-80-3 | 2A-1190818 |
| 2-AMINO-5-CHLOROBENZYL ALCOHOL | 37585-25-4 | 2A-1190819 |
| 2,2,2,3'-TETRAFLUOROACETOPHENONE | 708-64-5 | 2A-1190820 |
| 2-(3,5-DIFLUOROPHENYL)ETHANOYL CHLORIDE | 157033-24-4 | 2A-1190821 |
| 2,5-DIFLUORO-4-METHOXYBENZONITRILE | 1007605-44-8 | 2A-1190823 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA