
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3154-18-5 |
| Catalog No. | 2A-1190815 |
| Chinese Name | 4-乙氧基-N-甲基苯胺 |
| Synonyms | 4-Methylamino-phenol-aethylaether; N-Methyl-p-phenetidin; N-methylphenetidine; Benzenamine,4-ethoxy-N-methyl; N-methyl-p-phenetidine |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 8686485 |
| SMILES | CCOc1ccc(NC)cc1 |
| InChI | InChI=1S/C9H13NO/c1-3-11-9-6-4-8(10-2)5-7-9/h4-7,10H,3H2,1-2H3 |
| InChI Key | URTYQKUVSRCNAL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ethyl 6-bromo-2,2-dimethylhexanoate | 78712-62-6 | 2A-1190801 |
| 1,3-DICYCLOHEXYLBARBITURIC ACID | 35824-91-0 | 2A-1190804 |
| 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucose | 188783-78-0 | 2A-1190805 |
| Methyl 4-(difluoroMethoxy)-3-hydroxybenzoate | 1159429-52-3 | 2A-1190811 |
| 3-(5-HydroxypyriMidin-2-yl)benzoic acid Methyl ester | 1092568-87-0 | 2A-1190813 |
| 2H-Indazol-6-amine, N,2,3-trimethyl | 1376676-65-1 | 2A-1190816 |
| 3-Fluoro mandelic acid | 395-05-1 | 2A-1190817 |
| Geranic acid 85% stabilized | 459-80-3 | 2A-1190818 |
| 2-AMINO-5-CHLOROBENZYL ALCOHOL | 37585-25-4 | 2A-1190819 |
| 2,2,2,3'-TETRAFLUOROACETOPHENONE | 708-64-5 | 2A-1190820 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA