
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1207727-04-5 |
| Catalog No. | 2A-2189411 |
| Chinese Name | 溴虫氟苯双酰胺 |
| Synonyms | FXFFXFXFFFR CE EXFFF DMVR BF CN1&VR; broflanilide |
| Molecular Formula | C25H14O2N2Br1F11 |
| Molecular Weight | 663.28 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 467.9±45.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | 2-8°C, dry |
| Application | Broflanilide is an insecticide that can be decomposed into desmethyl-broflanilide, which is a specific insect dieldrin-resistant GABA receptor antagonist and inhibits Spodoptera litura RDL GABAR with |
| PubChem ID | 125006351 |
| MDL Number | MFCD31657367 |
| SMILES | CN(C(=O)c1ccccc1)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C25H14BrF11N2O2/c1-39(21(41)12-6-3-2-4-7-12)17-9-5-8-14(18(17)27)20(40)38-19-15(23(29,30)31)10-13(11-16(19)26)22(28,24(32,33)34)25(35,36)37/h2-11H,1H3,(H,38,40) |
| InChI Key | QSLZKWPYTWEWHC-UHFFFAOYSA-N |
| Transport Info | Product Name: Broflanilide |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4,5-trichloro acid Carolina | 2A-2189267 | 2A-2189267 |
| 5-amino-2,4-di-tert-butylphenyl methyl carbonate | 1182822-31-6 | 2A-1189285 |
| 5-(3-chloro-2-fluorobenzyl)-2,4-diMethoxybenzoic acid | 949465-79-6 | 2A-2189286 |
| N,N'-Bis(2,4-dimethylphenyl)-N,N'-diphenylbenzidine | 122738-25-4 | 2A-2189363 |
| 2,4,5-TRICHLOROBENZENESULFONYL CHLORIDE | 15945-07-0 | 2A-2189375 |
| Tembotrione [iso] | 335104-84-2 | 2A-2189414 |
| 2-(5,6-dimethyl-2,4-dioxo-1,4-dihydrothieno[2,3-d]pyrimidin-3(2H)-yl)-2-methylpropanoic acid | 1367906-61-3 | 2A-2189507 |
| FENOXAPROP | 73519-55-8 | 2A-4189630 |
| 2,4-DIMETHYL-6-IODOANILINE | 4102-54-9 | 2A-1189636 |
| METHYL 2,4-DIHYDROXY-6-METHYLNICOTINATE | 893616-55-2 | 2A-1189659 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA