
CAS Number1182822-31-6
SynonymsQC-4868; 1X1&1&R BZ DOVO1 EX1&1&1; 5-amino-2,4-di-tert-butylphenyl methyl carbonate; 5-Amino-2,4-bis(2-methyl-2-propanyl)phenyl methyl carbonate; Carbonic acid, 5-amino-2,4-bis(1,1-dimethylethyl)phenyl methyl ester
Molecular FormulaC16H25NO3
Molecular Weight279.38
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point371.6±42.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1182822-31-6 |
| Catalog No. | 2A-1189285 |
| Chinese Name | 5-氨基-2,4-二叔丁基苯甲酸甲酯 |
| Synonyms | QC-4868; 1X1&1&R BZ DOVO1 EX1&1&1; 5-amino-2,4-di-tert-butylphenyl methyl carbonate; 5-Amino-2,4-bis(2-methyl-2-propanyl)phenyl methyl carbonate; Carbonic acid, 5-amino-2,4-bis(1,1-dimethylethyl)phenyl methyl ester |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 371.6±42.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, stored und |
| HTC | 2922199090 |
| PubChem ID | 99433556 |
| SMILES | COC(=O)Oc1cc(N)c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C16H25NO3/c1-15(2,3)10-8-11(16(4,5)6)13(9-12(10)17)20-14(18)19-7/h8-9H,17H2,1-7H3 |
| InChI Key | NEMQZDZEKFZZJT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloro-6-(dibenzo[b,d]furan-2-yl)-1,3,5-triazine | 1699739-77-9 | 2A-2189164 |
| 2,4-Dihydroxy-6-propylbenzoic acid | 4707-50-0 | 2A-2189214 |
| L-Phenylalanine, 4-(6-methyl-1,2,4,5-tetrazin-3-yl)- | 1698038-85-5 | 2A-2189241 |
| Sodium 2,4,5-trichlorobenzenesulphonate | 6378-25-2 | 2A-2189263 |
| 2,4,5-trichloro acid Carolina | 2A-2189267 | 2A-2189267 |
| 5-(3-chloro-2-fluorobenzyl)-2,4-diMethoxybenzoic acid | 949465-79-6 | 2A-2189286 |
| N,N'-Bis(2,4-dimethylphenyl)-N,N'-diphenylbenzidine | 122738-25-4 | 2A-2189363 |
| 2,4,5-TRICHLOROBENZENESULFONYL CHLORIDE | 15945-07-0 | 2A-2189375 |
| Broflanilide | 1207727-04-5 | 2A-2189411 |
| Tembotrione [iso] | 335104-84-2 | 2A-2189414 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA