
CAS Number118-33-2
Synonymskyselinaamino-i; MFCD00021513; 6-amino-1,3-naphthalenedisulfonic; 6-Aminonaphthalene-1,3-disulfonic acid; amino-iacid; 2-amino-naphthalene-5,7-disulfonic acid; 2-naftylamin-5,7-disulfonansodny; 2-Naphthylamine-5,7-disulfonicaacid; 2-Naphthylamin-5,7-disulfonsure; AMINO J-ACID; 6-amino-3-naphthalenedisulfonicacid; 2-NAPHTHYLAMINE-5,7-DISULPHONIC ACID; EINECS 204-246-1; 2-amino-5,7-naphthalenedisulfonic acid; 6-amino-1,3-naphthalene-disulfonic acid
Molecular FormulaC10H9NO6S2
Molecular Weight303.31200
Purity98.00%
Density1.769g/cm3
AppearanceLight yellow to greenish yellow solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 118-33-2 |
| Catalog No. | 2A-9018994 |
| Chinese Name | 2-氨基-5,7-萘二磺酸 |
| Synonyms | kyselinaamino-i; MFCD00021513; 6-amino-1,3-naphthalenedisulfonic; 6-Aminonaphthalene-1,3-disulfonic acid; amino-iacid; 2-amino-naphthalene-5,7-disulfonic acid; 2-naftylamin-5,7-disulfonansodny; 2-Naphthylamine-5,7-disulfonicaacid; 2-Naphthylamin-5,7-disulfonsure; AMINO J-ACID; 6-amino-3-naphthalenedisulfonicacid; 2-NAPHTHYLAMINE-5,7-DISULPHONIC ACID; EINECS 204-246-1; 2-amino-5,7-naphthalenedisulfonic acid; 6-amino-1,3-naphthalene-disulfonic acid |
| Molecular Formula | C10H9NO6S2 |
| Molecular Weight | 303.31200 |
| Purity | 98.00 |
| Density | 1.769g/cm3 |
| Appearance | Light yellow to greenish yellow solid |
| Storage Condition | Ventilate and dry at low temperature. |
| Packaging | III |
| HTC | 2921499090 |
| SMILES | Nc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H9NO6S2/c11-7-1-2-9-6(3-7)4-8(18(12,13)14)5-10(9)19(15,16)17/h1-5H,11H2,(H,12,13,14)(H,15,16,17) |
| InChI Key | KZCSUEYBKAPKNH-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/18994_1_118_33_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Trifluoperazine | 117-89-5 | 2A-9018981 |
| Quinaldine Red | 117-92-0 | 2A-9018982 |
| Zinc bis(pentachlorothiophenolate) | 117-97-5 | 2A-9018983 |
| 1-Naphthalenemethylamine | 118-31-0 | 2A-9018992 |
| 7-Hydroxynaphthalene-1,3-disulfonic acid | 118-32-1 | 2A-9018993 |
| 3,4,5-Trimethoxybenzoic acid | 118-41-2 | 2A-9018996 |
| N-Ethyl-1-naphthylamine | 118-44-5 | 2A-9018998 |
| 1-Amino-7-naphthol | 118-46-7 | 2A-9019000 |
| 1-(4'-Sulfophenyl)-3-carboxy-5-pyrazolone | 118-47-8 | 2A-9019001 |
| Isatoic anhydride | 118-48-9 | 2A-9019002 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA