
CAS Number117-89-5
SynonymsTrifluperazine; Trifluoperazina; triphthazine dihydrochloride; EINECS 204-219-4; Flurazine; Triflurin; 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine; Triftazin; Trifluoroperazine; Triperazine; Stelazine; Trifluoperazin; NOVO-TRIFLUZINETM; trifluoroperazine hydrochloride; trifluoroperazine dihydrochloride
Molecular FormulaC21H24F3N3S
Molecular Weight407.5
Purity98.00%
Density1.239g/cm3
Boiling Point506ºC at 760mmHg
Melting Point232°C
AppearanceWhite to light yellow crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 117-89-5 |
| Catalog No. | 2A-9018981 |
| Chinese Name | 三氟拉嗪 |
| Synonyms | Trifluperazine; Trifluoperazina; triphthazine dihydrochloride; EINECS 204-219-4; Flurazine; Triflurin; 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine; Triftazin; Trifluoroperazine; Triperazine; Stelazine; Trifluoperazin; NOVO-TRIFLUZINETM; trifluoroperazine hydrochloride; trifluoroperazine dihydrochloride |
| Molecular Formula | C21H24F3N3S |
| Molecular Weight | 407.5 |
| Purity | 98.00 |
| Density | 1.239g/cm3 |
| Boiling Point | 506ºC at 760mmHg |
| Melting Point | 232°C |
| Appearance | White to light yellow crystalline powder |
| HTC | 2934300000 |
| MDL Number | C21H24F3N3S |
| SMILES | CN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C21H24F3N3S/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)28-20-8-7-16(15-18(20)27)21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3 |
| InChI Key | ZEWQUBUPAILYHI-UHFFFAOYSA-N |
| MSDS | msds/18981_1_117_89_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 8-Hydroxynaphthalene-1,6-disulfonic acid | 117-43-1 | 2A-9018970 |
| 1-Naphthol-5-sulfonic acid | 117-59-9 | 2A-9018972 |
| Benzidine-2,2'-disulphonic acid | 117-61-3 | 2A-9018973 |
| 2-Amino-1,5-naphthalenedisulfonic acid | 117-62-4 | 2A-9018974 |
| Bis(2-methoxyethyl) phthalate | 117-82-8 | 2A-9018978 |
| Quinaldine Red | 117-92-0 | 2A-9018982 |
| Zinc bis(pentachlorothiophenolate) | 117-97-5 | 2A-9018983 |
| 1-Naphthalenemethylamine | 118-31-0 | 2A-9018992 |
| 7-Hydroxynaphthalene-1,3-disulfonic acid | 118-32-1 | 2A-9018993 |
| 2-Naphthylamine-5,7-disulfonic acid | 118-33-2 | 2A-9018994 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA