
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1362-42-1 |
| Catalog No. | 2A-1188253 |
| Chinese Name | 洋艾素 |
| Synonyms | Sbsinthin; ABSINTHII TINCTURA; ABSYNTHIN; Absinthiin; Absynthine |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 700.6±60.0 °C at 760 mmHg |
| Melting Point | 165-166℃ (dec.) |
| Application | Absinthin is a triterpenoid with a unique structure, which is the reason why mugwort has a high bitter taste. Absinthin is an agonist of the bitter taste receptor hTAS2R46 and reduces histamine-induce |
| PubChem ID | 11477 |
| MDL Number | MFCD00272148 |
| SMILES | CC1=CC2C3C4C(=C(C)C3C13C1OC(=O)C(C)C1CCC(C)(O)C23)C1OC(=O)C(C)C1CCC4(C)O |
| InChI | InChI=1S/C30H40O6/c1-12-11-18-20-21(30(12)24(18)29(6,34)10-8-17-14(3)27(32)36-25(17)30)15(4)19-22(20)28(5,33)9-7-16-13(2)26(31)35-23(16)19/h11,13-14,16-18,20-25,33-34H,7-10H2,1-6H3/t13-,14-,16-,17-,18+,20-,21-,22-,23-,24-,25-,28-,29-,30+/m0/s1 |
| InChI Key | PZHWYURJZAPXAN-ILOFNVQHSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Transport Info | Product name: absinthe |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| jolkinolide B | 37905-08-1 | 2A-1188248 |
| Frenolicin B | 68930-68-7 | 2A-1188249 |
| Kazinol U | 1238116-48-7 | 2A-1188250 |
| ROHITUKINE | 71294-60-5 | 2A-1188251 |
| Elaiophylin | 37318-06-2 | 2A-1188252 |
| 2H-Indol-2-one, 5,6-dichloro-3-[1,3-dihydro-3-(methoxyimino)-2H-indol-2-ylidene]-1,3-dihydro- | 2226664-93-1 | 2A-2188269 |
| 5-amino-1-methylquinolin-1-ium iodide | 42464-96-0 | 2A-2188270 |
| 6',7'-DIHYDROXYBERGAMOTTIN | 145414-76-2 | 2A-2188272 |
| dendrobine | 2115-91-5 | 2A-2188274 |
| Agrimoniin | 82203-01-8 | 2A-2188276 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA