
CAS Number656800-67-8
Synonyms3,5,6,7-tetrahydro-2-methyl-4-bromo-s-hydraindacen-1-one; 4-Bromo-2-methyl-2,3,6,7-tetrahydro-s-indacen-1(5H)-one; 4-Bromo-2-methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-one; 3,5,6,7-tetrahydro-2-methyl-4-bromo-s-hydraindacen-1(2H)-one; 4-bromo-2-methyl-2,3,6,7-tetrahydros-Indacen-1(5H)-one
Molecular FormulaC13H13O1Br1
Molecular Weight265.15
Density1.5±0.1 g/cm3
Boiling Point390.7±42.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 656800-67-8 |
| Catalog No. | 2A-2188127 |
| Chinese Name | 4-bromo-2-methyl-2,3,6,7-tetrahydros-indacen-1(5H)-one |
| Synonyms | 3,5,6,7-tetrahydro-2-methyl-4-bromo-s-hydraindacen-1-one; 4-Bromo-2-methyl-2,3,6,7-tetrahydro-s-indacen-1(5H)-one; 4-Bromo-2-methyl-3,5,6,7-tetrahydro-s-indacen-1(2H)-one; 3,5,6,7-tetrahydro-2-methyl-4-bromo-s-hydraindacen-1(2H)-one; 4-bromo-2-methyl-2,3,6,7-tetrahydros-Indacen-1(5H)-one |
| Molecular Formula | C13H13O1Br1 |
| Molecular Weight | 265.15 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 390.7±42.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2914700090 |
| PubChem ID | 46349423 |
| MDL Number | MFCD13193765 |
| SMILES | CC1Cc2c(cc3c(c2Br)CCC3)C1=O |
| InChI | InChI=1S/C13H13BrO/c1-7-5-10-11(13(7)15)6-8-3-2-4-9(8)12(10)14/h6-7H,2-5H2,1H3 |
| InChI Key | CIHJCNMNDZBXBD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-chloro-2-methyl-1-indanone | 64220-40-2 | 2A-2188121 |
| 5-Bromo-2-methyl-1-indanone | 104107-22-4 | 2A-2188122 |
| 4-chloro-2-methyl-1-indanone | 245653-50-3 | 2A-2188123 |
| 7-Bromo-2-methyl-1-indanone | 213381-43-2 | 2A-2188124 |
| 4-Bromo-2-isopropyl-1-indanone | 892575-08-5 | 2A-2188125 |
| 1,1-DIPHENYLBUT-1-ENE | 1726-14-3 | 2A-2188128 |
| 2-methyl-1,1-diphenyl-prop-1-ene | 761-33-9 | 2A-2188129 |
| 3,4-Dihydroxybutanoic Acid Sodium Salt | 40951-20-0 | 2A-1188112 |
| ETHYL TERT-BUTYLACETATE | 5340-78-3 | 2A-4188130 |
| H2N-PEG2-tBu | 756525-95-8 | 2A-2188133 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA