
CAS Number104107-22-4
Synonyms1H-Inden-1-one,5-bromo-2,3-dihydro-2-methyl; 2-methyl-5-bromo-1-indanone; 5-Bromo-2-methyl-2,3-dihydro-1H-inden-1-one; 5-bromo-2-methyl-1-indanone; 5-bromo-2-methyl-1-oxoindane; 5-BROMO-2-METHYL-INDAN-1-ONE
Molecular FormulaC10H9BrO
Molecular Weight226.07
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104107-22-4 |
| Catalog No. | 2A-2188122 |
| Chinese Name | 5-溴-2-甲基-1-茚酮 |
| Synonyms | 1H-Inden-1-one,5-bromo-2,3-dihydro-2-methyl; 2-methyl-5-bromo-1-indanone; 5-Bromo-2-methyl-2,3-dihydro-1H-inden-1-one; 5-bromo-2-methyl-1-indanone; 5-bromo-2-methyl-1-oxoindane; 5-BROMO-2-METHYL-INDAN-1-ONE |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 226.07 |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 35050586 |
| SMILES | CC1Cc2cc(Br)ccc2C1=O |
| InChI | InChI=1S/C10H9BrO/c1-6-4-7-5-8(11)2-3-9(7)10(6)12/h2-3,5-6H,4H2,1H3 |
| InChI Key | GMWXCOYOQNIWPE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-broMo-2-Methyl-1H-indene | 328085-65-0 | 2A-2188114 |
| 7-bromo-1H-indene | 16657-07-1 | 2A-2188115 |
| 6-Bromo-2-methyl-1-indanone | 176088-59-8 | 2A-2188119 |
| 4-fluoro-2-methyl-1-indanone | 52045-42-8 | 2A-2188120 |
| 5-chloro-2-methyl-1-indanone | 64220-40-2 | 2A-2188121 |
| 4-chloro-2-methyl-1-indanone | 245653-50-3 | 2A-2188123 |
| 7-Bromo-2-methyl-1-indanone | 213381-43-2 | 2A-2188124 |
| 4-Bromo-2-isopropyl-1-indanone | 892575-08-5 | 2A-2188125 |
| 4-bromo-2-methyl-2,3,6,7-tetrahydros-indacen-1(5H)-one | 656800-67-8 | 2A-2188127 |
| 1,1-DIPHENYLBUT-1-ENE | 1726-14-3 | 2A-2188128 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA