
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 102704-40-5 |
| Catalog No. | 2A-3186875 |
| Chinese Name | GAT-211 |
| Synonyms | MFCD02165420; GAT211; 3-(2-Nitro-1-phenylethyl)-2-phenyl-1H-indole |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.39 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 585.8±50.0 °C at 760 mmHg |
| Application | GAT-211 (GAT211) is a selective cannabinoid 1 receptor (CB1R) positive allosteric modulator with a pKb of 7.26 and an Arrestin2 EC50 of 775 nM; participates in the CB1R allosteric site, enhances the b |
| PubChem ID | 6488134 |
| MDL Number | MFCD02165420 |
| SMILES | O=[N+]([O-])CC(c1ccccc1)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H18N2O2/c25-24(26)15-19(16-9-3-1-4-10-16)21-18-13-7-8-14-20(18)23-22(21)17-11-5-2-6-12-17/h1-14,19,23H,15H2 |
| InChI Key | OHZDCJJHWPHZJD-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| Transport Info | Product name: GAT211 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| tert-butyl 4-(4-aMino-3-Methoxyphenyl)piperidine-1-carboxylate | 1089280-53-4 | 2A-3186853 |
| methyl 5-amino-1,2,4-thiadiazole-3-carboxylate | 75028-16-9 | 2A-3186857 |
| 8-fluoroquinoline-3-carbonitrile | 71083-52-8 | 2A-3186862 |
| 3-Cyclohexyl-N-[(dimethylamino)sulfonyl]-1H-indole-6-carboxamide | 1251033-29-0 | 2A-3186865 |
| 1-(6-chloro-5-(trifluoromethyl)pyridin-2-yl)piperazine | 132834-56-1 | 2A-3186873 |
| N3-(3-Chloro-4-fluorophenyl)-7-(pyridin-4-yl)furo[2,3-c]pyridine-2,3-diamine | 1638118-09-8 | 2A-3186876 |
| 2-(trifluoromethyl)azetidine | 1040331-55-2 | 2A-3186877 |
| 4-BROMO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID | 5194-37-6 | 2A-3186878 |
| 1-[2-Chloro-1-hydroxy-3-(6-quinolinyl)propyl]-2,5-pyrrolidinedione | 1197377-31-3 | 2A-3186889 |
| 1-methyl-3-((methylamino)methyl)-1H-pyrazole-5-carbonitrilehydrochloridesalt | 1643141-20-1 | 2A-3186891 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA