
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54063-52-4 |
| Catalog No. | 2A-1186589 |
| Chinese Name | 匹托非酮 |
| Synonyms | p'-Piperidino-aethoxy-o-carbmethoxybenzophenon; Pitofenone |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 403.90 |
| Purity | 98.00 |
| Boiling Point | 512ºC at 760mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933399090 |
| PubChem ID | 10239448 |
| MDL Number | MFCD01661944 |
| SMILES | COC(=O)c1ccccc1C(=O)c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-26-22(25)20-8-4-3-7-19(20)21(24)17-9-11-18(12-10-17)27-16-15-23-13-5-2-6-14-23/h3-4,7-12H,2,5-6,13-16H2,1H3 |
| InChI Key | NZHMAQSCHUSSSJ-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Nusinersen | 1258984-36-9 | 2A-3186577 |
| [(3S)-morpholin-3-yl]methanamine | 1250973-43-3 | 2A-3186584 |
| C.I. 14720 | 53026-69-9 | 2A-3186586 |
| tetrasodium 6-amino-4-hydroxy-3-[[7-sulphonato-4-[(4-sulphonatophenyl)azo]-1-naphthyl]azo]naphthalene-2,7-disulphonate | 2118-39-0 | 2A-3186587 |
| PATENT BLUE V | 3536-49-0 | 2A-3186588 |
| propoxypropanol | 30136-13-1 | 2A-3186591 |
| DI(PROPYLENE GLYCOL) PROPYL ETHER | 29911-27-1 | 2A-3186592 |
| POE (15) TALLOW AMINE | 61791-26-2 | 2A-3186594 |
| PITOFENONE HCl | 1248-42-6 | 2A-1186595 |
| Endo-hexahydro-8-hydroxy-2,6-methano-2H-quinolizin-3(4H)-one mesylate | 889135-55-1 | 2A-3186597 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA