
CAS Number79128-78-2
Synonyms1,3-Benzenedicarboxylic acid,4-hydroxy-,1-methyl ester; 4-Hydroxy-isophthalsaeure-1-methylester; methyl 3-carboxy-4-hydroxybenzoate; 2-hydroxy-5-(methoxycarbonyl)benzoic acid; 2-hydroxy-5-carbomethoxybenzoic acid; 4-hydroxy-isophthalic acid 1-methyl ester; 4-Hydroxy-isophthalsaeure-monomethylester-(1)
Molecular FormulaC9H8O5
Molecular Weight196.16
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79128-78-2 |
| Catalog No. | 2A-3186573 |
| Chinese Name | 2-羟基-5-(甲氧基羰基)苯甲酸 |
| Synonyms | 1,3-Benzenedicarboxylic acid,4-hydroxy-,1-methyl ester; 4-Hydroxy-isophthalsaeure-1-methylester; methyl 3-carboxy-4-hydroxybenzoate; 2-hydroxy-5-(methoxycarbonyl)benzoic acid; 2-hydroxy-5-carbomethoxybenzoic acid; 4-hydroxy-isophthalic acid 1-methyl ester; 4-Hydroxy-isophthalsaeure-monomethylester-(1) |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| PubChem ID | 24743682 |
| SMILES | COC(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H8O5/c1-14-9(13)5-2-3-7(10)6(4-5)8(11)12/h2-4,10H,1H3,(H,11,12) |
| InChI Key | LIQLYTSJSBMCAH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3-Dihydro-4-nitro-2H-indol-2-one | 61394-51-2 | 2A-3186565 |
| 7-METHYL-1,3-DIHYDRO-INDOL-2-ONE | 3680-28-2 | 2A-3186566 |
| 7-hydroxyindolin-2-one | 10238-74-1 | 2A-3186567 |
| 1,3-Dioxan-2-one | 2453-04-4 | 2A-3186570 |
| 2,6-Diethyl-4-methylbromobenzene | 314084-61-2 | 2A-3186571 |
| 3-Amino-2-picoline | 2A-3186574 | 2A-3186574 |
| N-(2-MERCAPTOETHYL)ACETAMIDE | 1190-73-4 | 2A-3186575 |
| 2-(2,4,5,7-Tetranitro-9-fluorenylideneaminooxy)propionic acid | 66069-40-7 | 2A-3186576 |
| Nusinersen | 1258984-36-9 | 2A-3186577 |
| [(3S)-morpholin-3-yl]methanamine | 1250973-43-3 | 2A-3186584 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA