
CAS Number452-10-8
Synonyms2,4-Difluoro-1-methoxybenzene; MFCD00010731; 2,4-Difluorophenyl methyl ether; 2,4-difluoro-anisole; 2,4-Difluor-anisol; 3,4-diflurobenzaldehyde; 2,4-difluoroanisol; 2.4-Difluor-1-methoxy-benzol; 2,4-DIFLUOROMETHOXY BENZENE; 1-Methoxy-2,4-difluorobenzene
Molecular FormulaC7H6O1F2
Molecular Weight144.12
Purity98%
Density1.2±0.1 g/cm3
Boiling Point155.8±0.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 452-10-8 |
| Catalog No. | 2A-9001876 |
| Chinese Name | 2,4-二氟苯甲醚 |
| Synonyms | 2,4-Difluoro-1-methoxybenzene; MFCD00010731; 2,4-Difluorophenyl methyl ether; 2,4-difluoro-anisole; 2,4-Difluor-anisol; 3,4-diflurobenzaldehyde; 2,4-difluoroanisol; 2.4-Difluor-1-methoxy-benzol; 2,4-DIFLUOROMETHOXY BENZENE; 1-Methoxy-2,4-difluorobenzene |
| Molecular Formula | C7H6O1F2 |
| Molecular Weight | 144.12 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 155.8±0.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Water Solubility | insoluble |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| Packaging | III |
| HTC | 2909309090 |
| MDL Number | MFCD00010731 |
| SMILES | COc1ccc(F)cc1F |
| InChI | InChI=1S/C7H6F2O/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
| InChI Key | CRMJLJFDPNJIQA-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/1876_1_452_10_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: III |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloropyrimidine | 3934-20-1 | 2A-9001869 |
| 2,4-Dichlorothiophenol | 1122-41-4 | 2A-9001870 |
| 2,4-Dichlorotoluene | 95-73-8 | 2A-9001871 |
| 2,4-Difluoro-3-methoxybenzoic acid | 178974-97-5 | 2A-9001873 |
| 2,4-Difluoroaniline | 367-25-9 | 2A-9001875 |
| 2,4-Difluorobenzaldehyde | 1550-35-2 | 2A-9001877 |
| 2,4-Difluorobenzaldehyde oxime | 247092-11-1 | 2A-9001878 |
| 2,4-Difluorobenzamide | 85118-02-1 | 2A-9001879 |
| 2,4-Difluorobenzenesulphonyl chloride | 13918-92-8 | 2A-9001880 |
| 2,4-Difluorobenzoic acid hydrazide | 118737-62-5 | 2A-9001881 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA