CAS Number178974-97-5
Synonyms2,4-difluoro-3-methoxylbenzoic acid; MFCD02258905; 2,4,6-TRICHLOROPHENYL 4-FLUOROBENZENESULFONATE; GVR BF DF CO1; 2,4-Difluoro-m-anisic acid; 3-Methoxy-2,4-difluorobenzoic acid; 2,4-Difluoro-3-methoxybenzoic acid; 2,4-Difluoro-3-methoxy benzoic acid
Molecular FormulaC8H6O3F2
Molecular Weight188.13
Purity98%
Density1.4±0.1 g/cm3
Boiling Point298.7±35.0 °C at 760 mmHg
Melting Point193-195°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 178974-97-5 |
| Catalog No. | 2A-9001873 |
| Chinese Name | 2,4-二氟-3-甲氧基苯甲酸 |
| Synonyms | 2,4-difluoro-3-methoxylbenzoic acid; MFCD02258905; 2,4,6-TRICHLOROPHENYL 4-FLUOROBENZENESULFONATE; GVR BF DF CO1; 2,4-Difluoro-m-anisic acid; 3-Methoxy-2,4-difluorobenzoic acid; 2,4-Difluoro-3-methoxybenzoic acid; 2,4-Difluoro-3-methoxy benzoic acid |
| Molecular Formula | C8H6O3F2 |
| Molecular Weight | 188.13 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 298.7±35.0 °C at 760 mmHg |
| Melting Point | 193-195°C |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2918990090 |
| MDL Number | MFCD02258905 |
| SMILES | COc1c(F)ccc(C(=O)O)c1F |
| InChI | InChI=1S/C8H6F2O3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3H,1H3,(H,11,12) |
| InChI Key | KWLIGHXPUYUTBH-UHFFFAOYSA-N |
| MSDS | msds/1873_1_178974_97_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichlorophenylhydrazine hydrochloride | 5446-18-4 | 2A-9001867 |
| 2,4-Dichloropyridine | 26452-80-2 | 2A-9001868 |
| 2,4-Dichloropyrimidine | 3934-20-1 | 2A-9001869 |
| 2,4-Dichlorothiophenol | 1122-41-4 | 2A-9001870 |
| 2,4-Dichlorotoluene | 95-73-8 | 2A-9001871 |
| 2,4-Difluoroaniline | 367-25-9 | 2A-9001875 |
| 2,4-Difluoroanisole | 452-10-8 | 2A-9001876 |
| 2,4-Difluorobenzaldehyde | 1550-35-2 | 2A-9001877 |
| 2,4-Difluorobenzaldehyde oxime | 247092-11-1 | 2A-9001878 |
| 2,4-Difluorobenzamide | 85118-02-1 | 2A-9001879 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS