
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38862-65-6 |
| Catalog No. | 2A-3185663 |
| Chinese Name | 2,4-二羟基-6-戊基苯甲酸乙酯 |
| Synonyms | 2,4-Dihydroxy-6-pentyl-benzoesaeure-aethylester; 2,4-dihydroxy-6-pentyl-benzoic acid ethyl ester; BENZOIC ACID,2,4-DIHYDROXY-6-PENTYL-,ETHYL ESTER |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 |
| Storage Condition | Room temperature, store in inert gas |
| HTC | 2918199090 |
| PubChem ID | 53910069 |
| MDL Number | MFCD11618127 |
| SMILES | CCCCCc1cc(O)cc(O)c1C(=O)OCC |
| InChI | InChI=1S/C14H20O4/c1-3-5-6-7-10-8-11(15)9-12(16)13(10)14(17)18-4-2/h8-9,15-16H,3-7H2,1-2H3 |
| InChI Key | ALCUWNWVZNZFHQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-dichloro-3-cyano-5-fluorobenzoic acid | 117528-58-2 | 2A-3185298 |
| 2,4-dihydroxy-6-propyl-benzoic acid methyl ester | 55382-52-0 | 2A-3185362 |
| 2-((2,4-DiMethylphenyl)thio)phenylaMine | 1019453-85-0 | 2A-3185374 |
| Benzenesulfonic acid, 3,6-dihydroxy-2,4-dimethyl- (9CI) | 735200-57-4 | 2A-3185638 |
| methyl 2,4-dihydroxy-6-pentylbenzoate | 58016-28-7 | 2A-3185662 |
| 4,4',4''-(1H-imidazole-2,4,5-triyl)tribenzoic acid | 2329408-06-0 | 2A-3185684 |
| 1,2,4,5-tetrakis [4 - (3',5'-dicarboxy-1,1'-biphenyl)] - 3,6 dimethylbenzene | 2098551-92-7 | 2A-3185698 |
| 1,2,4,5-Tetraethynylbenzene | 70603-31-5 | 2A-3185756 |
| 1,2,4,5-Tetrakis-(4-formylphenyl)benzene | 883835-33-4 | 2A-3185802 |
| 5,6-DiaMino-3-Methyl-1H-pyriMidin-2,4-dion | 40959-24-8 | 2A-3185879 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA