
CAS Number58016-28-7
Synonyms2,4-dihydroxy-6-pentyl-benzoic acid methyl ester; Benzoic acid,2,4-dihydroxy-6-pentyl-,methyl ester; methyl olivetocarboxylate; methyl 6-n-pentyl-2,4-dihydroxybenzoate; BEN570; 2,4-Dihydroxy-6-pentyl-benzoesaeure-methylester; methyl 2,6-dihydroxy-6-pentylbenzoate; Methyl olivetolate
Molecular FormulaC13H18O4
Molecular Weight238.28
AppearanceWhite to light yellow to yellow powder or crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58016-28-7 |
| Catalog No. | 2A-3185662 |
| Chinese Name | 2,4-二羟基-6-戊基苯甲酸甲酯 |
| Synonyms | 2,4-dihydroxy-6-pentyl-benzoic acid methyl ester; Benzoic acid,2,4-dihydroxy-6-pentyl-,methyl ester; methyl olivetocarboxylate; methyl 6-n-pentyl-2,4-dihydroxybenzoate; BEN570; 2,4-Dihydroxy-6-pentyl-benzoesaeure-methylester; methyl 2,6-dihydroxy-6-pentylbenzoate; Methyl olivetolate |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 |
| Appearance | White to light yellow to yellow powder or crystal |
| Storage Condition | room temperature, inert gas |
| PubChem ID | 31557420 |
| SMILES | CCCCCc1cc(O)cc(O)c1C(=O)OC |
| InChI | InChI=1S/C13H18O4/c1-3-4-5-6-9-7-10(14)8-11(15)12(9)13(16)17-2/h7-8,14-15H,3-6H2,1-2H3 |
| InChI Key | RQGAOBDPFOADCM-UHFFFAOYSA-N |
| Transport Info | Product name: Methyl 2,4-dihydroxy-6-pentylbenzoate |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-DICHLORO-3-METHYLBENZOIC ACID | 83277-23-0 | 2A-3185169 |
| 2,4-dichloro-3-cyano-5-fluorobenzoic acid | 117528-58-2 | 2A-3185298 |
| 2,4-dihydroxy-6-propyl-benzoic acid methyl ester | 55382-52-0 | 2A-3185362 |
| 2-((2,4-DiMethylphenyl)thio)phenylaMine | 1019453-85-0 | 2A-3185374 |
| Benzenesulfonic acid, 3,6-dihydroxy-2,4-dimethyl- (9CI) | 735200-57-4 | 2A-3185638 |
| BENZOIC ACID, 2,4-DIHYDROXY-6-PENTYL-, ETHYL ESTER | 38862-65-6 | 2A-3185663 |
| 4,4',4''-(1H-imidazole-2,4,5-triyl)tribenzoic acid | 2329408-06-0 | 2A-3185684 |
| 1,2,4,5-tetrakis [4 - (3',5'-dicarboxy-1,1'-biphenyl)] - 3,6 dimethylbenzene | 2098551-92-7 | 2A-3185698 |
| 1,2,4,5-Tetraethynylbenzene | 70603-31-5 | 2A-3185756 |
| 1,2,4,5-Tetrakis-(4-formylphenyl)benzene | 883835-33-4 | 2A-3185802 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA