CAS Number108-64-5
SynonymsUNII-9ZZ5597636; ethyl isovarelate; isovaleric acid cyclohexyl ester; butyric acid, 3-methyl-, ethyl ester; Cyclohexyl isovalerianate; Ethyl isovalerate; EINECS 203-602-3; Cyclohexylisovalerianat; Ethyl isovalerianate; Ethyl 3-methyl butanoate; Ethyl 3-methylbutyrate; cyclohexyl isovalerate; Butanoic acid, 3-methyl-, ethyl ester; Ethyl isopentanoate; Isovaleric Acid Ethyl Ester; Cyclohexyl isopentanoate; 3-methyl-butyric acid cyclohexyl ester; Ethyl 3-methylbutanoate; 3-methylbutanoic acid ethyl ester; Isovaleric acid, ethyl ester; ethyl iso-pentanoate; Ethyl β-methylbutyrate; Isovaleriansaeurecyclohexylester; MFCD00009203
Molecular Formula(CH3)2CHCH2COOC2H5
Molecular Weight130.18
Purity≥98%
Density0.9±0.1 g/cm3
Boiling Point131-133 °C (lit.)
Melting Point−99 °C (lit.)
AppearanceColorless liquid/strong, after dilution it has the smell of fruit, wine, apple
EINECS203-602-3
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 108-64-5 |
| Catalog No. | 2A-9018632 |
| Chinese Name | 3-甲基丁酸乙酯 |
| Synonyms | UNII-9ZZ5597636; ethyl isovarelate; isovaleric acid cyclohexyl ester; butyric acid, 3-methyl-, ethyl ester; Cyclohexyl isovalerianate; Ethyl isovalerate; EINECS 203-602-3; Cyclohexylisovalerianat; Ethyl isovalerianate; Ethyl 3-methyl butanoate; Ethyl 3-methylbutyrate; cyclohexyl isovalerate; Butanoic acid, 3-methyl-, ethyl ester; Ethyl isopentanoate; Isovaleric Acid Ethyl Ester; Cyclohexyl isopentanoate; 3-methyl-butyric acid cyclohexyl ester; Ethyl 3-methylbutanoate; 3-methylbutanoic acid ethyl ester; Isovaleric acid, ethyl ester; ethyl iso-pentanoate; Ethyl β-methylbutyrate; Isovaleriansaeurecyclohexylester; MFCD00009203 |
| Molecular Formula | (CH3)2CHCH2COOC2H5 |
| Molecular Weight | 130.18 |
| Purity | ≥98 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 131-133 °C (lit.) |
| Melting Point | −99 °C (lit.) |
| Appearance | Colorless liquid/strong, after dilution it has the smell of fruit, wine, apple |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | III |
| EINECS | 203-602-3 |
| HTC | 2915600000 |
| PubChem ID | 24901110 |
| MDL Number | MFCD00009203 |
| SMILES | CCOC(=O)CC(C)C |
| InChI | 1S/C7H14O2/c1-4-9-7(8)5-6(2)3/h6H,4-5H2,1-3H3 |
| InChI Key | PPXUHEORWJQRHJ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1744677 |
| NACRES Code | NA.21 |
| eCl@ss | 39022323 |
| UNSPSC | 12164502 |
| Hazard Symbols | 3 |
| MSDS | msds/18632_1_108_64_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Glutaric anhydride | 108-55-4 | 2A-9018626 |
| Diethyl oxalacetate | 108-56-5 | 2A-9018627 |
| 1,3-Diacetoxybenzene | 108-58-7 | 2A-9018628 |
| Dimethyl malonate | 108-59-8 | 2A-9018629 |
| 2,2'-Oxydipropanol | 108-61-2 | 2A-9018630 |
| 1-Methoxy-2-propyl acetate | 108-65-6 | 2A-9018633 |
| Cyanuric chloride | 108-77-0 | 2A-9018640 |
| Cyanuric acid | 108-80-5 | 2A-9018643 |
| Diisobutylcarbinol | 108-82-7 | 2A-9018644 |
| Cyclohexyl bromide | 108-85-0 | 2A-9018646 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS