
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 179314-60-4 |
| Catalog No. | 2A-3183820 |
| Chinese Name | 2-氨基-6-溴-4-氯苯酚 |
| Synonyms | 6-amino-2-bromo-4-chloro-phenol; 2-amino-6-bromo-4-chloro-phenol; 2-Amino-6-brom-4-chlor-phenol |
| Molecular Formula | C6H5BrClNO |
| Molecular Weight | 222.47 |
| Melting Point | 83-87°C |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2922299090 |
| PubChem ID | 329797076 |
| MDL Number | MFCD12402422 |
| SMILES | Nc1cc(Cl)cc(Br)c1O |
| InChI | InChI=1S/C6H5BrClNO/c7-4-1-3(8)2-5(9)6(4)10/h1-2,10H,9H2 |
| InChI Key | ISKCLWHHJKNMKI-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)aniline | 1609394-10-6 | 2A-1183812 |
| 1-KESTOSE | 470-69-9 | 2A-1183813 |
| 1,1,1,1-Kestohexose | 62512-19-0 | 2A-1183814 |
| D(+)-GLUCOSE MONOHYDRATE | 77938-63-7 | 2A-1183815 |
| NISTOSE | 13133-07-8 | 2A-1183816 |
| 2-(2-CHLOROETHOXY)TETRAHYDRO-2H-PYRAN | 5631-96-9 | 2A-3183821 |
| N-cyclohexyl-N-methyl-o-nitrobenzylamine | 80638-08-0 | 2A-3183826 |
| N-cyclohexyl-N-methyl-2-nitrobenzylamine monohydrochloride | 31611-42-4 | 2A-3183827 |
| tert-Butyl 4-chlorobutanoate | 3153-32-0 | 2A-1183829 |
| Arabinitol | 2152-56-9 | 2A-1183830 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA