
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30399-84-9 |
| Catalog No. | 2A-1182823 |
| Chinese Name | 异十八酸 |
| Synonyms | emersol875; emery871; century1105; emersol871; prisorine3502; 875d; emery875d; prisorine3508; prisorine3501 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 |
| Density | 0.888g/cm3 |
| Boiling Point | 359.4ºC at 760mmHg |
| Melting Point | 69.3ºC |
| Storage Condition | 2-8C |
| EINECS | 220-336-3 |
| HTC | 2915701000 |
| PubChem ID | 24897089 |
| MDL Number | MFCD00044082 |
| SMILES | CCCCCCCCCCCCCCCCCC(O)=O |
| InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
| InChI Key | InChIKey=QIQXTHQIDYTFRH-UHFFFAOYSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 12352211 |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Fatty acids, C16-18 and C18-unsatd., Me esters | 67762-38-3 | 2A-1182819 |
| S)-3-Cyano-5-methyl hexanoic acid ethyl ester | 181289-39-4 | 2A-2182819 |
| Trihydroxymethylpropyl trioleate | 11138-60-6 | 2A-1182820 |
| Boc Epoxy | 2A-3182820 | 2A-3182820 |
| 2-ethyl-2-[[(1-oxooctyl)oxy]methyl]-1,3-propanediyl dioctanoate | 4826-87-3 | 2A-1182822 |
| Alcohols, C12-14 | 80206-82-2 | 2A-1182825 |
| BETA-LACTOGLOBULIN B | 9066-45-9 | 2A-1182826 |
| Androstane, piperidinium deriv. | 16974-53-1 | 2A-1182827 |
| DOBUTAMINE HYDROCHLORIDE | 34368-04-2 | 2A-1182828 |
| Succinylcholine | 306-40-1 | 2A-1182829 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA