
CAS Number104-27-8
SynonymsEINECS 203-190-5; (1E)-1-(4-Methoxyphenyl)pent-1-en-3-one; 1-(4-Methoxyphenyl)-1-penten-3-one; (1E)-1-(4-Methoxyphenyl)-1-penten-3-one
Molecular FormulaC13H16O2
Molecular Weight204.271
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point333.2±17.0 °C at 760 mmHg
Appearancelight yellow crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104-27-8 |
| Catalog No. | 2A-9018382 |
| Chinese Name | 1-(4-甲氧苯基)-1-戊烯-3-酮 |
| Synonyms | EINECS 203-190-5; (1E)-1-(4-Methoxyphenyl)pent-1-en-3-one; 1-(4-Methoxyphenyl)-1-penten-3-one; (1E)-1-(4-Methoxyphenyl)-1-penten-3-one |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.271 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 333.2±17.0 °C at 760 mmHg |
| Appearance | light yellow crystal |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2914509090 |
| MDL Number | MFCD00026446 |
| SMILES | CCC(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H14O2/c1-3-11(13)7-4-10-5-8-12(14-2)9-6-10/h4-9H,3H2,1-2H3/b7-4+ |
| InChI Key | SLDQOBRACOQXGE-QPJJXVBHSA-N |
| MSDS | msds/18382_1_104_27_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Methylacetanilide | 103-89-9 | 2A-9018368 |
| 4-Chloro-N-methylbenzylamine | 104-11-0 | 2A-9018373 |
| 4-Butylaniline | 104-13-2 | 2A-9018375 |
| Anisyl acetate | 104-21-2 | 2A-9018380 |
| 4'-Aminoazobenzene-4-sulphonic acid | 104-23-4 | 2A-9018381 |
| Chlorphenesin | 104-29-0 | 2A-9018383 |
| Benzonatate | 104-31-4 | 2A-9018384 |
| Hydroquinone bis(2-hydroxyethyl)ether | 104-38-1 | 2A-9018386 |
| 4-Dodecylaniline | 104-42-7 | 2A-9018387 |
| cis-Anethol | 104-46-1 | 2A-9018388 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA