CAS Number103-09-3
Synonyms2-Ethyl-1-hexanol acetate; β-ethylhexyl acetate; 2-ethylhexylacetate; Acetic Acid 2-Ethylhexyl Ester; 2-Ethylhexyl acetate; Acetic acid,2-ethylhexyl ester; 2-Ethylhexanyl acetate; 2-Ethyl-1-hexyl acetate; 2-ethylhexan-1-ol acetate; 2-Ethylhexyl ethanoate; FEMA Number 2806; Acetic acid, 2-ethylhexyl ester; MFCD00027249; 2-ethyl-n-hexyl acetate; Octyl Acetate; EINECS 203-079-1
Molecular FormulaH3CCO2CH2CH(C2H5)(CH2)3CH3
Molecular Weight172.26
Purity≥99%
Density0.9±0.1 g/cm3
Boiling Point199 °C (lit.)
Melting Point−92 °C (lit.)
AppearanceTransparent colorless liquid
EINECS203-079-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 103-09-3 |
| Catalog No. | 2A-9018324 |
| Chinese Name | 乙酸异辛酯 |
| Synonyms | 2-Ethyl-1-hexanol acetate; β-ethylhexyl acetate; 2-ethylhexylacetate; Acetic Acid 2-Ethylhexyl Ester; 2-Ethylhexyl acetate; Acetic acid,2-ethylhexyl ester; 2-Ethylhexanyl acetate; 2-Ethyl-1-hexyl acetate; 2-ethylhexan-1-ol acetate; 2-Ethylhexyl ethanoate; FEMA Number 2806; Acetic acid, 2-ethylhexyl ester; MFCD00027249; 2-ethyl-n-hexyl acetate; Octyl Acetate; EINECS 203-079-1 |
| Molecular Formula | H3CCO2CH2CH(C2H5)(CH2)3CH3 |
| Molecular Weight | 172.26 |
| Purity | ≥99 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 199 °C (lit.) |
| Melting Point | −92 °C (lit.) |
| Appearance | Transparent colorless liquid |
| Water Solubility | Water solubility: slightly soluble; miscible: alco |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| EINECS | 203-079-1 |
| HTC | 29153990 |
| PubChem ID | 24902074 |
| MDL Number | MFCD00027249 |
| SMILES | CCCCC(CC)COC(C)=O |
| InChI | 1S/C10H20O2/c1-4-6-7-10(5-2)8-12-9(3)11/h10H,4-8H2,1-3H3 |
| InChI Key | WOYWLLHHWAMFCB-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| MSDS | msds/18324_1_103_09_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cinnamoyl chloride | 102-92-1 | 2A-9018318 |
| 3-Phenyl-propionamide | 102-93-2 | 2A-9018319 |
| N-Benzylisopropylamine | 102-97-6 | 2A-9018320 |
| (Phenylthio)acetic acid | 103-04-8 | 2A-9018322 |
| 2-Methyl-4-phenylbutan-2-ol | 103-05-9 | 2A-9018323 |
| 4-Benzyloxyphenol | 103-16-2 | 2A-9018326 |
| Methyl 3-phenylpropionate | 103-25-3 | 2A-9018328 |
| Methyl cinnamate | 103-26-4 | 2A-9018329 |
| Benzyl isobutyrate | 103-28-6 | 2A-9018330 |
| N-Phenylbenzylamine | 103-32-2 | 2A-9018333 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS