
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26405-77-6 |
| Catalog No. | 2A-4181145 |
| Chinese Name | 肾上腺素磺酸 |
| Synonyms | Epinephrine Sulfonic Acid; Epininsulfonsaeure |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.26800 |
| Purity | 98% |
| HTC | 2922299090 |
| SMILES | CNCC(c1ccc(O)c(O)c1)S(=O)(=O)O |
| InChI Key | TYYGQMPOZGEFQL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ALPHA-D-GALACTURONIC ACID HYDRATE | 91510-62-2 | 2A-4181132 |
| galacturonic acid | 14982-50-4 | 2A-4181133 |
| D-GALACTURONIC ACID | 14984-39-5 | 2A-4181134 |
| D-(+)-Galacturonic acid | 6294-16-2 | 2A-4181135 |
| D-(+)Glucuronic acid | 18968-14-4 | 2A-4181136 |
| Acetoacetic Acid | 541-50-4 | 2A-4181146 |
| benzylidene glucose | 25152-90-3 | 2A-4181147 |
| 1,5-ANHYDRO-4,6-O-BENZYLIDENE-D-GLUCITOL | 65190-39-8 | 2A-4181148 |
| 1,3-O-Benzylidene-D-arabitol | 70831-50-4 | 2A-4181149 |
| N/A | 2365-78-2 | 2A-1181152 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA