
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14984-39-5 |
| Catalog No. | 2A-4181134 |
| Chinese Name | D-半乳糖醛酸 钠盐 |
| Synonyms | D-(+)-GALACTURONIC ACID SODIUM SALT; D-Galacturonic acid sodium salt; MFCD06201013 |
| Molecular Formula | C6H9NaO7 |
| Molecular Weight | 216.12 |
| Purity | 98% |
| Storage Condition | Keep it tightly closed. Store in a cool, dry locat |
| Application | D-(+)-galacturonic acid sodium salt is a biochemical reagent that can be used as a biological material or organic compound for life science-related research. |
| PubChem ID | 329765362 |
| MDL Number | MFCD06201013 |
| SMILES | O=CC(O)C(O)C(O)C(O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h1-5,8-11H,(H,12,13);/q;+1/p-1/t2-,3+,4+,5-;/m0./s1 |
| InChI Key | WNFHGZLVUQBPMA-RMTXHFLUSA-M |
| NACRES Code | NA.22 |
| UNSPSC | 12352201 |
| Transport Info | Product name: D-galacturonic acid sodium salt |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5,6-O-Isopropylidene-L-gulonic acid-1,4-lactone | 94697-68-4 | 2A-4181129 |
| D-MANNONO-1,4-LACTONE | 26301-79-1 | 2A-4181130 |
| Ammonium-D-xylonate | 5461-96-1 | 2A-4181131 |
| ALPHA-D-GALACTURONIC ACID HYDRATE | 91510-62-2 | 2A-4181132 |
| galacturonic acid | 14982-50-4 | 2A-4181133 |
| D-(+)-Galacturonic acid | 6294-16-2 | 2A-4181135 |
| D-(+)Glucuronic acid | 18968-14-4 | 2A-4181136 |
| (+/-)-EPINEPHRINE SULFONIC ACID | 26405-77-6 | 2A-4181145 |
| Acetoacetic Acid | 541-50-4 | 2A-4181146 |
| benzylidene glucose | 25152-90-3 | 2A-4181147 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA