
CAS Number37456-21-6
Synonyms6,8-Di(tert-butyl)-4-oxo-4H-1-benzopyran-2-carboxylic acid; terbucromil; 6,8-Di-t-butyl-4-oxo-4H-1-benzopyran-2-carbonsaeure; 6,8-di-t-butyl-4-oxo-4H-1-benzopyran-2-carboxylic acid; 6,8-di-tert-butyl-4-oxo-4H-chromene-2-carboxylic acid
Molecular FormulaC18H22O4
Molecular Weight302.36500
Purity98.00%
Density1.159g/cm3
Boiling Point402.8ºC at 760 mmHg
Melting Point229ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37456-21-6 |
| Catalog No. | 2A-9018192 |
| Chinese Name | 异丁色酮酸 |
| Synonyms | 6,8-Di(tert-butyl)-4-oxo-4H-1-benzopyran-2-carboxylic acid; terbucromil; 6,8-Di-t-butyl-4-oxo-4H-1-benzopyran-2-carbonsaeure; 6,8-di-t-butyl-4-oxo-4H-1-benzopyran-2-carboxylic acid; 6,8-di-tert-butyl-4-oxo-4H-chromene-2-carboxylic acid |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.36500 |
| Purity | 98.00 |
| Density | 1.159g/cm3 |
| Boiling Point | 402.8ºC at 760 mmHg |
| Melting Point | 229ºC |
| HTC | 2918300090 |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(C(=O)O)cc(=O)c2c1 |
| InChI | InChI=1S/C18H22O4/c1-17(2,3)10-7-11-13(19)9-14(16(20)21)22-15(11)12(8-10)18(4,5)6/h7-9H,1-6H3,(H,20,21) |
| InChI Key | CJTURQGHQPDNDA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Aminothiazole | 96-50-4 | 2A-9017972 |
| N-Methyl pyrrole | 96-54-8 | 2A-9017974 |
| Piperidine pentamethylenedithiocarbamate | 98-77-1 | 2A-9018088 |
| methyl6-chloropyridazine-4-carboxylate | 1093860-48-0 | 2A-9018105 |
| 2,5-Pyridinedicarboxylic acid | 100-26-5 | 2A-9018186 |
| 4-Vinylpyridine | 100-43-6 | 2A-9018199 |
| 4-Cyanopyridine | 100-48-1 | 2A-9018203 |
| 3-Pyridinemethanol | 100-55-0 | 2A-9018210 |
| 2-Cyanopyridine | 100-70-9 | 2A-9018220 |
| 2-Ethylpyridine | 100-71-0 | 2A-9018221 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA