
CAS Number99-59-2
Synonyms2-Amino-4-nitro anisidine; 5-Nitro-2-methoxyaniline; 2-Amino-4-Nitroanisole; 2-Methoxy-5-nitrobenzenamine; 3-Amino-4-methoxynitrobenzene; MFCD00007261; 2-Methoxy-5-nitroaniline; 5-Nitro-2-anisidine; EINECS 202-770-5; WNR CZ DO1
Molecular FormulaC13H9N3O5
Molecular Weight287.234
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point351.8±22.0 °C at 760 mmHg
Melting Point117-119 °C(lit.)
AppearanceOrange to brown powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 99-59-2 |
| Catalog No. | 2A-9018143 |
| Chinese Name | 2-氨基-4-硝基苯甲醚 |
| Synonyms | 2-Amino-4-nitro anisidine; 5-Nitro-2-methoxyaniline; 2-Amino-4-Nitroanisole; 2-Methoxy-5-nitrobenzenamine; 3-Amino-4-methoxynitrobenzene; MFCD00007261; 2-Methoxy-5-nitroaniline; 5-Nitro-2-anisidine; EINECS 202-770-5; WNR CZ DO1 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.234 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 351.8±22.0 °C at 760 mmHg |
| Melting Point | 117-119 °C(lit.) |
| Appearance | Orange to brown powder |
| Water Solubility | Slightly soluble. |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| Packaging | I; II; III |
| HTC | 2922299090 |
| MDL Number | MFCD00414181 |
| SMILES | COc1ccc(cc1N)[N+]([O-])=O |
| InChI | InChI=1S/C7H8N2O3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,8H2,1H3 |
| InChI Key | InChIKey=NIPDVSLAMPAWTP-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/18143_1_99_59_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methyl-4-nitroanisole | 99-53-6 | 2A-9018137 |
| 2-Methyl-5-nitroaniline | 99-55-8 | 2A-9018139 |
| 4-Nitro-o-phenylenediamine | 99-56-9 | 2A-9018140 |
| 2-Amino-4-nitrophenol | 99-57-0 | 2A-9018141 |
| 3-Bromo-4-methoxybenzoic acid | 99-58-1 | 2A-9018142 |
| 2-Chloro-4-nitrobenzoic acid | 99-60-5 | 2A-9018144 |
| 3-(Dimethylamino)benzoic acid | 99-64-9 | 2A-9018147 |
| 2-Propylpentanoic acid | 99-66-1 | 2A-9018149 |
| 4-(2-Butyl)phenol | 99-71-8 | 2A-9018150 |
| 2,4'-Dibromoacetophenone | 99-73-0 | 2A-9018151 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA