
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 552-57-8 |
| Catalog No. | 2A-0200312 |
| Chinese Name | 异野漆树苷 |
| Synonyms | Einecs 209-015-9; APIGENIN-7-O-RUTINOSIDE; Apigenin-7-rutinoside |
| Molecular Formula | C27H30O14 |
| Molecular Weight | 578.52 |
| Purity | 98% |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 912.7±65.0 °C at 760 mmHg |
| Melting Point | 270-275ºC |
| Appearance | yellow powder |
| Storage Condition | 2-8℃, dry, sealed |
| Application | Isorhoifolin is a flavonoid glycoside from the leaves of periploca nigrescens. Isorhoifolin has an anti-leakage effect. |
| PubChem ID | 14813288 |
| MDL Number | MFCD00148889 |
| SMILES | CC1OC(OCC2OC(Oc3cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc4c3)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C27H30O14/c1-10-20(31)22(33)24(35)26(38-10)37-9-18-21(32)23(34)25(36)27(41-18)39-13-6-14(29)19-15(30)8-16(40-17(19)7-13)11-2-4-12(28)5-3-11/h2-8,10,18,20-29,31-36H,9H2,1H3 |
| InChI Key | FKIYLTVJPDLUDL-SLNHTJRHSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Transport Info | Product Name: Isinoanacardiin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-CHLORO-N-METHYL-N-(4-NITROPHENYL)ACETAMIDE | 2653-16-9 | 2A-4180238 |
| 2-isopropoxy-5-Methyl-4-(piperidin-4-yl)benzenaMine | 1035230-24-0 | 2A-4180239 |
| 4-(4-Fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2(1H)-one | 132812-72-7 | 2A-4180240 |
| 4-(4-BroMo-3-(1,3-dioxolan-2-yl)phenoxy)benzonitrile | 1217366-74-9 | 2A-4180246 |
| acepromazine | 61-00-7 | 2A-1180248 |
| TETRAMETHYLURIC ACID | 2309-49-1 | 2A-4180250 |
| 4-DesMethyl Istradefylline | 160434-48-0 | 2A-4180251 |
| (E)-4-(diMethylaMino)but-2-enoic acid | 98548-81-3 | 2A-4180253 |
| METHYL 3-CHLORO-2-NITROBENZOATE | 42087-81-0 | 2A-4180255 |
| N/A | 473423-59-4 | 2A-1180260 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA