
CAS Number61-00-7
SynonymsVetranquil; 1-[10-(3-Dimethylamino-propyl)-phenothiazin-2-yl]-aethanon; Notensil; Acetylperazine; Acetylpromazine; 1-[10-(3-dimethylamino-propyl)-phenothiazin-2-yl]-ethanone
Molecular FormulaC19H22N2OS
Molecular Weight326.464
Purity98.00%
Density1.1075 (rough estimate)
Boiling Pointbp0.5 220-240°
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61-00-7 |
| Catalog No. | 2A-1180248 |
| Chinese Name | 乙酰丙嗪 |
| Synonyms | Vetranquil; 1-[10-(3-Dimethylamino-propyl)-phenothiazin-2-yl]-aethanon; Notensil; Acetylperazine; Acetylpromazine; 1-[10-(3-dimethylamino-propyl)-phenothiazin-2-yl]-ethanone |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.464 |
| Purity | 98.00 |
| Density | 1.1075 (rough estimate) |
| Boiling Point | bp0.5 220-240° |
| Storage Condition | Warehouse ventilation and low temperature drying |
| HTC | 2934300000 |
| PubChem ID | 605809 |
| MDL Number | MFCD00867988 |
| SMILES | CC(=O)c1ccc2c(c1)N(CCCN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C19H22N2OS.C4H4O4/c1-14(22)15-9-10-19-17(13-15)21(12-6-11-20(2)3)16-7-4-5-8-18(16)23-19;5-3(6)1-2-4(7)8/h4-5,7-10,13H,6,11-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChI Key | NOSIYYJFMPDDSA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea | 796848-79-8 | 2A-4180237 |
| 2-CHLORO-N-METHYL-N-(4-NITROPHENYL)ACETAMIDE | 2653-16-9 | 2A-4180238 |
| 2-isopropoxy-5-Methyl-4-(piperidin-4-yl)benzenaMine | 1035230-24-0 | 2A-4180239 |
| 4-(4-Fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2(1H)-one | 132812-72-7 | 2A-4180240 |
| 4-(4-BroMo-3-(1,3-dioxolan-2-yl)phenoxy)benzonitrile | 1217366-74-9 | 2A-4180246 |
| ISORHOIFOLIN | 552-57-8 | 2A-0200312 |
| TETRAMETHYLURIC ACID | 2309-49-1 | 2A-4180250 |
| 4-DesMethyl Istradefylline | 160434-48-0 | 2A-4180251 |
| (E)-4-(diMethylaMino)but-2-enoic acid | 98548-81-3 | 2A-4180253 |
| METHYL 3-CHLORO-2-NITROBENZOATE | 42087-81-0 | 2A-4180255 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA