
CAS Number79498-31-0
Synonymsent-7,14-Dihydroxy-16-kauren-3,15-dione; Glaucocalyxin A; (5β,7α,8α,9β,10α,13α,14R)-7,14-Dihydroxykaur-16-ene-3,15-dione
Molecular FormulaC20H28O4
Molecular Weight332.44
Density1.2±0.1 g/cm3
Boiling Point513.4±50.0 °C at 760 mmHg
Melting Point219.5-220.5℃
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79498-31-0 |
| Catalog No. | 2A-0179293 |
| Chinese Name | 蓝萼甲素 |
| Synonyms | ent-7,14-Dihydroxy-16-kauren-3,15-dione; Glaucocalyxin A; (5β,7α,8α,9β,10α,13α,14R)-7,14-Dihydroxykaur-16-ene-3,15-dione |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 513.4±50.0 °C at 760 mmHg |
| Melting Point | 219.5-220.5℃ |
| Storage Condition | 2-8°C |
| Application | Glaucocalyxin A, an enantiomeric lauryl diterpene from Rabdosia japonica var., inhibits the nuclear translocation of GLI1 by regulating the PI3K/Akt signaling pathway, thereby inducing osteosarcoma ap |
| PubChem ID | 15495368 |
| MDL Number | MFCD31560787 |
| SMILES | C=C1C(=O)C23C(O)CC4C(C)(C)C(=O)CCC4(C)C2CCC1C3O |
| InChI | InChI=1S/C20H28O4/c1-10-11-5-6-12-19(4)8-7-14(21)18(2,3)13(19)9-15(22)20(12,16(10)23)17(11)24/h11-13,15,17,22,24H,1,5-9H2,2-4H3/t11?,12-,13+,15+,17?,19-,20?/m0/s1 |
| InChI Key | UCDVIBNDYLUWFP-MJTHGBBVSA-N |
| Transport Info | Product name: Blue calyxin A |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| BENZYL (3-BROMO-2-OXOPROPYL)CARBAMATE | 131713-50-3 | 2A-1179284 |
| 2,2-Dimethyl-5-(hydroxymethyl)-1,3-dixoane | 4728-12-5 | 2A-1179286 |
| 4-(1,3-BENZOTHIAZOL-2-YL)PHENOL | 6265-55-0 | 2A-1179287 |
| Momordicoside A | 75801-95-5 | 2A-1179291 |
| glaucocalyxin B | 80508-81-2 | 2A-1179292 |
| PERFLUORODODECANE | 307-59-5 | 2A-1179294 |
| 21-Acetoxy-11β-hydroxy-16α,17α-propylmethylenedioxpregna-1,4-diene-3,20-dione | 51333-05-2 | 2A-3179304 |
| 21-Acetoxy-11-oxo-16α,17α-propylMethylenedioxpregna-1,4-diene-3,20-dione | 1831164-04-5 | 2A-3179305 |
| (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol | 949095-98-1 | 2A-3179310 |
| 2,3,3,3-TETRAFLUOROPROPENE | 754-12-1 | 2A-4179311 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA