
CAS Number80508-81-2
Synonyms14beta-Acetoxy-7alpha-hydroxy-ent-kaur-16-ene-3,15-dione; Wangzaozin C; (5β,7α,9β,10α,14S)-7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate
Molecular FormulaC22H30O5
Molecular Weight374.48
Density1.2±0.1 g/cm3
Boiling Point509.1±50.0 °C at 760 mmHg
Melting Point190.5-191 ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80508-81-2 |
| Catalog No. | 2A-1179292 |
| Chinese Name | 蓝萼乙素 |
| Synonyms | 14beta-Acetoxy-7alpha-hydroxy-ent-kaur-16-ene-3,15-dione; Wangzaozin C; (5β,7α,9β,10α,14S)-7-Hydroxy-3,15-dioxokaur-16-en-14-yl acetate |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 509.1±50.0 °C at 760 mmHg |
| Melting Point | 190.5-191 ºC |
| Water Solubility | Slightly soluble (0.29 g/L) (25 ºC), calculated |
| Storage Condition | 2-8°C |
| Application | Glaucocalyxin B is an enantio-kaurane diterpene isolated from the traditional Chinese medicine Herbaceae, which has anti-cancer and anti-inflammatory activities. The IC50 value for reducing HL-60 grow |
| PubChem ID | 103681149 |
| MDL Number | C22H30O5 |
| SMILES | C=C1C(=O)C23C(O)CC4C(C)(C)C(=O)CCC4(C)C2CCC1C3OC(C)=O |
| InChI | InChI=1S/C22H30O5/c1-11-13-6-7-14-21(5)9-8-16(24)20(3,4)15(21)10-17(25)22(14,18(11)26)19(13)27-12(2)23/h13-15,17,19,25H,1,6-10H2,2-5H3/t13?,14-,15+,17+,19-,21-,22?/m0/s1 |
| InChI Key | LSUXOKVMORWDLT-FFQMZICYSA-N |
| Transport Info | Product name: Blue calyxin B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2-diacetyl-indane | 58920-75-5 | 2A-1179283 |
| BENZYL (3-BROMO-2-OXOPROPYL)CARBAMATE | 131713-50-3 | 2A-1179284 |
| 2,2-Dimethyl-5-(hydroxymethyl)-1,3-dixoane | 4728-12-5 | 2A-1179286 |
| 4-(1,3-BENZOTHIAZOL-2-YL)PHENOL | 6265-55-0 | 2A-1179287 |
| Momordicoside A | 75801-95-5 | 2A-1179291 |
| glaucocalyxin A | 79498-31-0 | 2A-0179293 |
| PERFLUORODODECANE | 307-59-5 | 2A-1179294 |
| 21-Acetoxy-11β-hydroxy-16α,17α-propylmethylenedioxpregna-1,4-diene-3,20-dione | 51333-05-2 | 2A-3179304 |
| 21-Acetoxy-11-oxo-16α,17α-propylMethylenedioxpregna-1,4-diene-3,20-dione | 1831164-04-5 | 2A-3179305 |
| (RS)-4-(3-MethylaMino-1-thiophen-2-yl-propyl)-naphthalen-1-ol | 949095-98-1 | 2A-3179310 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA