
CAS Number3586-15-0
Synonyms3-Phenoxy-benzoesaeure-chlorid; 3-phenoxybenzoic acid chloride; m-phenoxybenzoyl chloride; meta-phenoxybenzoyl chloride; Benzoyl chloride,3-phenoxy; 3-phenoxy-benzoyl chloride
Molecular FormulaC13H9ClO2
Molecular Weight232.66200
Density1.247g/cm3
Boiling Point330ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3586-15-0 |
| Catalog No. | 2A-3179161 |
| Chinese Name | 3-苯氧基苯甲酰氯 |
| Synonyms | 3-Phenoxy-benzoesaeure-chlorid; 3-phenoxybenzoic acid chloride; m-phenoxybenzoyl chloride; meta-phenoxybenzoyl chloride; Benzoyl chloride,3-phenoxy; 3-phenoxy-benzoyl chloride |
| Molecular Formula | C13H9ClO2 |
| Molecular Weight | 232.66200 |
| Density | 1.247g/cm3 |
| Boiling Point | 330ºC at 760mmHg |
| Storage Condition | 2-8°C, sealed, dry |
| HTC | 2918990090 |
| SMILES | O=C(Cl)c1cccc(Oc2ccccc2)c1 |
| InChI Key | TTZXIWBOKOZOPL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| POLY(2-ETHYL-2-OXAZOLINE) | 25805-17-8 | 2A-4179154 |
| 3,5-Dichlorobenzylmagnesium Chloride | 107549-25-7 | 2A-3179154 |
| 2-Chloro-4-Methoxy-Benzoic Acid-Methyl Ester | 104253-45-4 | 2A-3179155 |
| 4-Bromo-2methyl Benzamide | 868776-08-3 | 2A-3179159 |
| 3-(Benzyloxy)Benzoyl Chloride | 61535-46-4 | 2A-3179160 |
| 4-Chloro-2,6-Dimethyl-Benzonitrile | 5757-67-5 | 2A-3179165 |
| (Diethyl(1-Cyano-3-Methylbutyl)Malonate | 186038-82-4 | 2A-3179166 |
| 6-Bromo-5-Chloro-Indan-1-One | 1260013-71-5 | 2A-3179167 |
| O-Benzyl Psilocin | 28383-23-5 | 2A-2179169 |
| Phenol, 2-(6,8-dibromo-2-quinolinyl) | 860784-08-3 | 2A-2179178 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA