
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61535-46-4 |
| Catalog No. | 2A-3179160 |
| Chinese Name | 3-苯甲氧基苯甲酰氯 |
| Synonyms | 3-benzyloxyl-benzoyl chloride; 3-benzyloxy-benzoic acid chloride; MFCD02258040 |
| Molecular Formula | C15H12ClNO5 |
| Molecular Weight | 321.72 |
| Density | 1.23g/cm3 |
| Boiling Point | 368.7ºC at 760 mmHg |
| Melting Point | 40-42℃ |
| Storage Condition | Dispose under dry protective gas, store in a seale |
| Packaging | II |
| HTC | 2918990090 |
| MDL Number | MFCD00183340 |
| SMILES | O=C(Cl)c1cccc(OCc2ccccc2)c1 |
| InChI Key | HPVUGOBQRQUWMK-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/179891_1_61535_46_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PENTANOCHLOR | 2307-68-8 | 2A-3179153 |
| POLY(2-ETHYL-2-OXAZOLINE) | 25805-17-8 | 2A-4179154 |
| 3,5-Dichlorobenzylmagnesium Chloride | 107549-25-7 | 2A-3179154 |
| 2-Chloro-4-Methoxy-Benzoic Acid-Methyl Ester | 104253-45-4 | 2A-3179155 |
| 4-Bromo-2methyl Benzamide | 868776-08-3 | 2A-3179159 |
| 3-Phenoxybenzoyl Chlorid | 3586-15-0 | 2A-3179161 |
| 4-Chloro-2,6-Dimethyl-Benzonitrile | 5757-67-5 | 2A-3179165 |
| (Diethyl(1-Cyano-3-Methylbutyl)Malonate | 186038-82-4 | 2A-3179166 |
| 6-Bromo-5-Chloro-Indan-1-One | 1260013-71-5 | 2A-3179167 |
| O-Benzyl Psilocin | 28383-23-5 | 2A-2179169 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA