
CAS Number364-71-6
SynonymsMFCD00007830; 2-Fluoracetoxy-benzoesaeure; EINECS 206-666-0; 2-fluoroacetoxy-benzoic acid; 2-Fluor-9-benzyl-adenin; 9-Benzyl-2-Fluoradenin; Adenine,9-benzyl-2-fluoro; 9-benzyl-2-fluoro-9H-purin-6-ylamine; 9-benzyl-2-fluoro-9h-purin-6-amine
Molecular FormulaC8H9FN2O3
Molecular Weight200.171
Density1.366g/cm3
Boiling Point329.2ºC at 760mmHg
Melting Point90-94ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 364-71-6 |
| Catalog No. | 2A-1178780 |
| Chinese Name | 4-氟-2-硝基苯胺 |
| Synonyms | MFCD00007830; 2-Fluoracetoxy-benzoesaeure; EINECS 206-666-0; 2-fluoroacetoxy-benzoic acid; 2-Fluor-9-benzyl-adenin; 9-Benzyl-2-Fluoradenin; Adenine,9-benzyl-2-fluoro; 9-benzyl-2-fluoro-9H-purin-6-ylamine; 9-benzyl-2-fluoro-9h-purin-6-amine |
| Molecular Formula | C8H9FN2O3 |
| Molecular Weight | 200.171 |
| Density | 1.366g/cm3 |
| Boiling Point | 329.2ºC at 760mmHg |
| Melting Point | 90-94ºC(lit.) |
| HTC | 2918990090 |
| MDL Number | MFCD00033886 |
| SMILES | O=C(CF)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H7FO4/c10-5-8(11)14-7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,12,13) |
| InChI Key | ISJRKJAXVBVDDK-UHFFFAOYSA-N |
| MSDS | msds/179480_1_364_71_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,4-dioxocane-5,8-dione | 21962-84-5 | 2A-1178772 |
| 1,4-dioxecane-5,10-dione | 15498-31-4 | 2A-1178773 |
| β-Dihydromuconic acid | 4440-68-0 | 2A-1178774 |
| AZD9496 | 1639042-08-2 | 2A-1178776 |
| TRANS-SIDURON PESTANAL 250 MG | 19123-21-8 | 2A-1178779 |
| Gemfibrozil | 25812-30-0 | 2A-4178780 |
| 3-Fluoro-4-bromo aniline | 656-65-6 | 2A-1178781 |
| 3',4',5'-trimethoxycinnamoyl chloride | 10263-19-1 | 2A-1178785 |
| 4-Methyl-1-phenylquinolin-2(1H)-one | 2540-30-9 | 2A-1178787 |
| 2-CYANOPROP-2-ENOIC ACID | 263703-32-8 | 2A-1178789 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA