
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30611-21-3 |
| Catalog No. | 2A-1178692 |
| Chinese Name | 4-戊酰氯苯甲酸甲酯 |
| Synonyms | 4-PENTANOYL-BENZOIC ACID METHYL ESTER; p-valerylbenzoic acid methyl ester; Methyl-4-valeroylbenzoat |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| Storage Condition | room temperature, dry |
| HTC | 2918300090 |
| MDL Number | MFCD09031818 |
| SMILES | CCCCC(=O)c1ccc(C(=O)OC)cc1 |
| InChI Key | LSDGSJYZSOPREL-UHFFFAOYSA-N |
| MSDS | msds/179387_1_30611_21_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Toceranib Phosphate | 874819-74-6 | 2A-1178686 |
| Benzene, 2-fluoro-4-iodo-1-Methoxy- | 3824-21-3 | 2A-1178688 |
| DIMETHYL 2-HYDROXYTEREPHTHALATE | 6342-72-9 | 2A-4178668 |
| 2-isopropyl-4-methylanisole | 31574-44-4 | 2A-1178690 |
| Methanone, [4-(hydroxyMethyl)phenyl]phenyl- | 81449-01-6 | 2A-1178691 |
| Cis-4-Aminoadamantan-1-ol hydrochloride | 62075-26-7 | 2A-1178697 |
| methyl 2-(5-bromo-2-methoxyphenyl)acetate | 294860-58-5 | 2A-1178703 |
| methyl 2-(3-chlorophenoxy)acetate | 74411-14-6 | 2A-1178704 |
| 4-phenyl-2-Thiophenamine | 67637-83-6 | 2A-1178709 |
| 2,5-DIAMINO-1,4-DIHYDROXYBENZENE DIHYDROCHLORIDE | 24171-03-7 | 2A-4178710 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA