
CAS Number6342-72-9
Synonymshydroxy-terephthalic acid dimethyl ester; hydroxy dimethyl terephthalate; Hydroxy-terephthalsaeure-dimethylester; dimethyl 2-hydroxyterephthalate; 2-Hydroxyterephthalsaeure-dimethylester; 2-hydroxyterephthalic acid dimethyl ester
Molecular FormulaC10H10O5
Molecular Weight210.19
Purity98%%
Density1.284g/cm3
Boiling Point327.6ºC at 760 mmHg
Melting Point92-93℃
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6342-72-9 |
| Catalog No. | 2A-4178668 |
| Chinese Name | 2-羟基对苯二甲酸二甲酯 |
| Synonyms | hydroxy-terephthalic acid dimethyl ester; hydroxy dimethyl terephthalate; Hydroxy-terephthalsaeure-dimethylester; dimethyl 2-hydroxyterephthalate; 2-Hydroxyterephthalsaeure-dimethylester; 2-hydroxyterephthalic acid dimethyl ester |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.19 |
| Purity | 98% |
| Density | 1.284g/cm3 |
| Boiling Point | 327.6ºC at 760 mmHg |
| Melting Point | 92-93℃ |
| Storage Condition | room temperature, inert gas |
| HTC | 2918199090 |
| MDL Number | MFCD08445666 |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(O)c1 |
| InChI | InChI=1S/C10H10O5/c1-14-9(12)6-3-4-7(8(11)5-6)10(13)15-2/h3-5,11H,1-2H3 |
| InChI Key | CJOJIAKIRLKBOO-UHFFFAOYSA-N |
| MSDS | msds/179384_1_6342_72_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-VINYL-BENZOIC ACID ETHYL ESTER | 2715-43-7 | 2A-1178683 |
| 4-(Ethoxyethoxy)styrene | 157057-20-0 | 2A-1178684 |
| 3,4-DIFLUOROSTYRENE | 405-03-8 | 2A-1178685 |
| Toceranib Phosphate | 874819-74-6 | 2A-1178686 |
| Benzene, 2-fluoro-4-iodo-1-Methoxy- | 3824-21-3 | 2A-1178688 |
| 2-isopropyl-4-methylanisole | 31574-44-4 | 2A-1178690 |
| Methanone, [4-(hydroxyMethyl)phenyl]phenyl- | 81449-01-6 | 2A-1178691 |
| 4-PENTANOYL-BENZOIC ACID METHYL ESTER | 30611-21-3 | 2A-1178692 |
| Cis-4-Aminoadamantan-1-ol hydrochloride | 62075-26-7 | 2A-1178697 |
| methyl 2-(5-bromo-2-methoxyphenyl)acetate | 294860-58-5 | 2A-1178703 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA