
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35065-12-4 |
| Catalog No. | 2A-3178552 |
| Chinese Name | 3-(4'-羟基)苯氧基苯甲酸 |
| Synonyms | 3-(4-hydroxyphenoxy)benzoic acid |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.361 |
| Density | 1.346g/cm3 |
| Boiling Point | 437.2ºC at 760 mmHg |
| Melting Point | 156-157.5 °C |
| Appearance | Light brown crystalline powder |
| Storage Condition | 2-8°C |
| HTC | 2918990090 |
| MDL Number | MFCD03932168 |
| SMILES | O=C(O)c1cccc(Oc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C13H10O4/c14-10-4-6-11(7-5-10)17-12-3-1-2-9(8-12)13(15)16/h1-8,14H,(H,15,16) |
| InChI Key | OSGCDVKVZWMYBG-UHFFFAOYSA-N |
| MSDS | msds/179196_1_35065_12_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4NP-SCA | 5315-87-7 | 2A-3178547 |
| AMOZ | 43056-63-9 | 2A-3178548 |
| 2NP-AMOZ | 183193-59-1 | 2A-3178549 |
| AOZ | 80-65-9 | 2A-3178550 |
| 4-Hydroxy methyl butonoate | 2A-3178551 | 2A-3178551 |
| DP1(Dipropargyl R-amino indane) | 2A-3178553 | 2A-3178553 |
| N-2-propene-1yl-2-chloro-R-aminoindane (2-Cl-AAI) | 2A-3178554 | 2A-3178554 |
| Isobutyl Vinyl Ketone | 2177-32-4 | 2A-3178555 |
| N-(1-methylethyl)-2-phenoxyethyl benzylamine | 2A-3178556 | 2A-3178556 |
| N-(4-chloro-2-((hydroxyimino)(phenyl)methyl) phenyl)-2-(methylamino)acetamide | 2A-2178558 | 2A-2178558 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA