
CAS Number5315-87-7
Synonyms4-Nitro-benzaldehyd-semicarbazon; p-nitrobenzylidene methylhydrazine; 4-nitrobenzaldehyde semicarbazone; p-nitrobenzaldehyde semicarbazone; para-nitrobenzaldehyde semicarbazone; 4-nitrobenzaldehyde methylhydrazone; p-Nitrobenzaldehyd-methylhydrazon; 4-Nitro-benzaldehyd-<methyl-hydrazon>
Molecular FormulaC8H8N4O3
Molecular Weight208.17400
Density1.46g/cm3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5315-87-7 |
| Catalog No. | 2A-3178547 |
| Chinese Name | (E)-2-(4-硝基亚苄基)肼-1-甲酰胺 |
| Synonyms | 4-Nitro-benzaldehyd-semicarbazon; p-nitrobenzylidene methylhydrazine; 4-nitrobenzaldehyde semicarbazone; p-nitrobenzaldehyde semicarbazone; para-nitrobenzaldehyde semicarbazone; 4-nitrobenzaldehyde methylhydrazone; p-Nitrobenzaldehyd-methylhydrazon; 4-Nitro-benzaldehyd-<methyl-hydrazon> |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.17400 |
| Density | 1.46g/cm3 |
| Storage Condition | room temperature |
| HTC | 2928000090 |
| SMILES | NC(=O)NN=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H8N4O3/c9-8(13)11-10-5-6-1-3-7(4-2-6)12(14)15/h1-5H,(H3,9,11,13)/b10-5+ |
| InChI Key | PMJVNUNOOIWGHN-BJMVGYQFSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Zileuton Sulfoxide | 1147524-83-1 | 2A-3178539 |
| Zuclopenthixol acetate | 85721-05-7 | 2A-3178543 |
| 2,3-dihydroxy propyl 4-hydroxy Benzoate | 93778-15-5 | 2A-3178544 |
| 3-(methylmaleimido)propionic acid N-Succinimidyl ester | 2A-3178545 | 2A-3178545 |
| Dihydralazine mesylate | 69467-96-5 | 2A-3178546 |
| AMOZ | 43056-63-9 | 2A-3178548 |
| 2NP-AMOZ | 183193-59-1 | 2A-3178549 |
| AOZ | 80-65-9 | 2A-3178550 |
| 4-Hydroxy methyl butonoate | 2A-3178551 | 2A-3178551 |
| 3-(4-Hydroxy)phenoxy benzoi acid | 35065-12-4 | 2A-3178552 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA