
CAS Number954-16-5
SynonymsMesityl phenyl ketone; MFCD02685558; Ketone, mesityl phenyl; EINECS 403-150-9; 2,4,6-trimethyl-benzophenone; Benzoylmesitylene; Mesitylphenylketon; phenyl mesityl ketone; Ketone,mesityl phenyl; Mesityl(phenyl)methanone; Mesitylene,2-benzoyl; Benzophenone,2,4,6-trimethyl
Molecular FormulaC16H16O
Molecular Weight224.298
Purity99.5%
Density1.0±0.1 g/cm3
Boiling Point315.0±11.0 °C at 760 mmHg
Melting Point35 - 36ºC
AppearanceTransparent to yellow semi-solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 954-16-5 |
| Catalog No. | 2A-9001788 |
| Chinese Name | 2,4,6-三甲基二苯甲酮 |
| Synonyms | Mesityl phenyl ketone; MFCD02685558; Ketone, mesityl phenyl; EINECS 403-150-9; 2,4,6-trimethyl-benzophenone; Benzoylmesitylene; Mesitylphenylketon; phenyl mesityl ketone; Ketone,mesityl phenyl; Mesityl(phenyl)methanone; Mesitylene,2-benzoyl; Benzophenone,2,4,6-trimethyl |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.298 |
| Purity | 99.5 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 315.0±11.0 °C at 760 mmHg |
| Melting Point | 35 - 36ºC |
| Appearance | Transparent to yellow semi-solid |
| Storage Condition | Room temperature, dry |
| Inventory | 975g |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H16O/c1-11-9-12(2)15(13(3)10-11)16(17)14-7-5-4-6-8-14/h4-10H,1-3H3 |
| InChI Key | HPAFOABSQZMTHE-UHFFFAOYSA-N |
| MSDS | msds/1788_1_954_16_5.pdf |
| Transport Info | Product name: 2,4,6-trimethylbenzophenone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,4,6-Trifluoronitrobenzene | 315-14-0 | 2A-9001780 |
| 2,4,6-Trifluorophenol | 2268-17-9 | 2A-9001781 |
| 2',4',6'-Trihydroxyacetophenone | 480-66-0 | 2A-9001783 |
| 2,4,6-Trimethoxyphenol | 20491-92-3 | 2A-9001785 |
| 2,4,6-Trimethylbenzoic acid | 480-63-7 | 2A-9001787 |
| 2,4,6-Trimethylbenzoyl chloride | 938-18-1 | 2A-9001789 |
| 2,4,6-Trimethylbenzyl chloride | 1585-16-6 | 2A-9001790 |
| 2,4'-Dichloro-4-aminodiphenyl ether | 24900-79-6 | 2A-9001831 |
| 2,4'-Dichloro-4-nitrodiphenyl ether | 22544-07-6 | 2A-9001832 |
| 2',4'-Dichloro-5'-fluoro-3'-nitroacetophenone | 2A-101836 | 2A-9001836 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA