
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4437-22-3 |
| Catalog No. | 2A-1178105 |
| Chinese Name | 二糠基醚 |
| Synonyms | 2-(furan-2-ylmethoxymethyl)furan |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 |
| Density | 1.15g/cm3 |
| Boiling Point | 228.7ºC at 760 mmHg |
| Appearance | liquid or semi-solid or solid |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2932190090 |
| MDL Number | MFCD01725820 |
| SMILES | c1coc(COCc2ccco2)c1 |
| InChI | InChI=1S/C10H10O3/c1-3-9(12-5-1)7-11-8-10-4-2-6-13-10/h1-6H,7-8H2 |
| InChI Key | YEQMNLGBLPBBNI-UHFFFAOYSA-N |
| MSDS | msds/178737_1_4437_22_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-fluorophenyl)-2-(piperidin-1-yl)ethane-1,2-dione | 1268138-60-8 | 2A-2178097 |
| 1-(3-fluorophenyl)-2-((2-hydroxyethyl)amino)propan-1-ol | 1874218-36-6 | 2A-2178098 |
| IDRA 21 | 22503-72-6 | 2A-2178099 |
| 1-(naphthalen-2-yl)-2-(piperidin-1-yl)ethane-1,2-dione | 128592-64-3 | 2A-2178100 |
| ETHYL 2-MERCAPTOPROPIONATE | 209-37-9 | 2A-1178103 |
| N/A | 623-19-8 | 2A-1178106 |
| N/A | 2432-42-0 | 2A-1178107 |
| 2-((2-hydroxyethyl)amino)-1-(p-tolyl)propan-1-ol | 1368274-08-1 | 2A-2178108 |
| 3-(3,4-dichlorophenyl)pentanedioic acid | 103860-25-9 | 2A-2178110 |
| 3-(3,4-dichlorophenyl)pentanedioate | 1704731-34-9 | 2A-2178111 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA