
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 94-01-9 |
| Catalog No. | 2A-9017833 |
| Chinese Name | 1,3-二苯甲酰氧基苯 |
| Synonyms | EINECS 202-294-8; (3-benzoyloxyphenyl) benzoate; MFCD00016576 |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.332 |
| Purity | 98.00 |
| Density | 1.242g/cm3 |
| Boiling Point | 450 °C |
| Melting Point | 115-117 °C |
| Storage Condition | This product should be kept sealed. |
| HTC | 2916399090 |
| MDL Number | MFCD00016576 |
| SMILES | O=C(Oc1cccc(OC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C20H14O4/c21-19(15-8-3-1-4-9-15)23-17-12-7-13-18(14-17)24-20(22)16-10-5-2-6-11-16/h1-14H |
| InChI Key | SUQGLJRNDJRARS-UHFFFAOYSA-N |
| MSDS | msds/17833_1_94_01_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Phenyl-1,3-butanedione | 93-91-4 | 2A-9017828 |
| Styralyl acetate | 93-92-5 | 2A-9017829 |
| Benzoic anhydride | 93-97-0 | 2A-9017830 |
| Benzanilide | 93-98-1 | 2A-9017831 |
| Phenyl benzoate | 93-99-2 | 2A-9017832 |
| Ethyl benzoylacetate | 94-02-0 | 2A-9017834 |
| Ethyl (ethoxymethylene)cyanoacetate | 94-05-3 | 2A-9017835 |
| Synephrine | 94-07-5 | 2A-9017836 |
| Ethyl 4-methylbenzoate | 94-08-6 | 2A-9017837 |
| Benzocaine | 94-09-7 | 2A-9017838 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA