
CAS Number11113-62-5
Synonyms(3S,9S,15S)-4,10,16-trimethyl-3,6,9,12,15,18-hexa(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone; (3S,9S,15S)-3,6,9,12,15,18-hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone; (3S,9S,15S)-3,6,9,12,15,18-hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-triquinone; Enniatin
Molecular FormulaC138H240N12O36
Molecular Weight677.62
Appearancelyophilized powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 11113-62-5 |
| Catalog No. | 2A-1177716 |
| Chinese Name | Enniatin complex |
| Synonyms | (3S,9S,15S)-4,10,16-trimethyl-3,6,9,12,15,18-hexa(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone; (3S,9S,15S)-3,6,9,12,15,18-hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone; (3S,9S,15S)-3,6,9,12,15,18-hexaisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-triquinone; Enniatin |
| Molecular Formula | C138H240N12O36 |
| Molecular Weight | 677.62 |
| Appearance | lyophilized powder |
| Water Solubility | Stock solutions are stable in water or buffer for |
| Application | Enniatin complex is a mixture of cyclohexanase peptides isolated primarily from the fungus Fusarium and possesses ionophore, antibiotic, and in vitro hypolipidemic properties. Enniatin complex inhibit |
| PubChem ID | 24891067 |
| MDL Number | MFCD00135957 |
| SMILES | Cl[H].Cl[H].[H]C(=O)C(CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)NC(Cc1ccccc1)C(O)=O)C(C)C |
| InChI | 1S/C27H44N10O6.2ClH/c1-16(2)21(23(40)34-18(15-38)10-6-12-32-25(28)29)37-22(39)19(11-7-13-33-26(30)31)35-27(43)36-20(24(41)42)14-17-8-4-3-5-9-17;;/h3-5,8-9,15-16,18-21H,6-7,10-14H2,1-2H3,(H,34,40)(H,37,39)(H,41,42)(H4,28,29,32)(H4,30,31,33)(H2,35,36,43);2*1H/t18?,19-,20?,21-;;/m0../s1 |
| InChI Key | YAHXZYICKJUJEO-BXLPLHKWSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352202 |
| Transport Info | Product Name: Adrenaline Complex |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CYTOCHALASIN C | 22144-76-9 | 2A-1177711 |
| 15-ACETOXY-3ALPHA,7ALPHA-DIHYDROXY-12,13-EPOXYTRICHOTHEC-9-EN-8-ONE | 88337-96-6 | 2A-1177712 |
| destruxin B | 2503-26-6 | 2A-1177713 |
| 3-ACETYLDEOXYNIVALENOL | 50722-38-8 | 2A-1177714 |
| DIHYDROERGOCRISTINE MESYLATE | 24730-10-7 | 2A-1177715 |
| enniatin A | 2503-13-1 | 2A-1177717 |
| enniatin A1 | 4530-21-6 | 2A-1177718 |
| ENNIATIN B | 917-13-5 | 2A-1177719 |
| enniatin B1 | 19914-20-6 | 2A-1177720 |
| ERGOCRISTINE | 511-08-0 | 2A-1177721 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA