CAS Number92-92-2
Synonyms[1,1'-Biphenyl]-4-carboxylic acid; Biphenyl-4-carboxylic acid; p-Phenylbenzoic Acid; 4-Phenylbenzic acid; 4-Carboxybiphenyl; PHENYLBENZOICACID; EINECS 202-203-1; RARECHEM AL BO 0062; 4-phenyl benzoic acid; 4-Biphenylcarboxylic; 4-Phenylbenzoic Acid; 4-CARBOXYDIPHENYL; 4-United acid; 4-Biphenylcarboxylic acid; MFCD00002553
Molecular FormulaC6H5C6H4CO2H
Molecular Weight198.22
Purity95%
Density1.2±0.1 g/cm3
Boiling Point372.6±21.0 °C at 760 mmHg
Melting Point220-225 °C (lit.)
Appearancecrystals
EINECS202-203-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 92-92-2 |
| Catalog No. | 2A-9017781 |
| Chinese Name | 4-苯基苯甲酸 |
| Synonyms | [1,1'-Biphenyl]-4-carboxylic acid; Biphenyl-4-carboxylic acid; p-Phenylbenzoic Acid; 4-Phenylbenzic acid; 4-Carboxybiphenyl; PHENYLBENZOICACID; EINECS 202-203-1; RARECHEM AL BO 0062; 4-phenyl benzoic acid; 4-Biphenylcarboxylic; 4-Phenylbenzoic Acid; 4-CARBOXYDIPHENYL; 4-United acid; 4-Biphenylcarboxylic acid; MFCD00002553 |
| Molecular Formula | C6H5C6H4CO2H |
| Molecular Weight | 198.22 |
| Purity | 95 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 372.6±21.0 °C at 760 mmHg |
| Melting Point | 220-225 °C (lit.) |
| Appearance | crystals |
| Water Solubility | Water solubility: Practically insoluble; soluble i |
| Storage Condition | This product should be sealed and stored in a cool |
| EINECS | 202-203-1 |
| HTC | 29163900 |
| PubChem ID | 24891723 |
| MDL Number | MFCD00002553 |
| SMILES | OC(=O)c1ccc(cc1)-c2ccccc2 |
| InChI | 1S/C13H10O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,14,15) |
| InChI Key | NNJMFJSKMRYHSR-UHFFFAOYSA-N |
| Beilstein/REAXYS | 973519 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/17781_1_92_92_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-Dibromosalicylaldehyde | 90-59-5 | 2A-9017675 |
| 1,2-Bis(bromomethyl)benzene | 91-13-4 | 2A-9017692 |
| 4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde | 92-10-4 | 2A-9017735 |
| 4-Diethylamino-2-methylbenzaldehyde | 92-14-8 | 2A-9017737 |
| 5-Nitro-2-furaldehyde diacetate | 92-55-7 | 2A-9017756 |
| 2,5-Dimethoxybenzaldehyde | 93-02-7 | 2A-9017786 |
| Dimethyl 1,4-cyclohexanedicarboxylate | 94-60-0 | 2A-9017860 |
| Pralidoxime iodide | 94-63-3 | 2A-9017862 |
| Salicylaldoxime | 94-67-7 | 2A-9017865 |
| 5-Norbornene-2-methylamine | 95-10-3 | 2A-9017883 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS