
CAS Number91-49-6
SynonymsN-butylacetoanilide; N-butyl acetylaniline; N-n-butyl acetanilide; MFCD00053789; N-Butyl-acetanilid; EINECS 202-071-5; Caswell No. 124; Butylacetanilide; Acetanilide,N-butyl; Essigsaeure-butylanilid; Acetamide,N-butyl-N-phenyl; N-butyl-N-phenyl-acetamide; N-BUTYLACETANILIDE
Molecular FormulaC12H17NO
Molecular Weight191.26900
Purity98.00%
Density0.9303 g/cm3 (16 C)
Boiling Point273 - 275ºC
Melting Point215-220 °C (dec.)(lit.)
AppearanceTransparent to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 91-49-6 |
| Catalog No. | 2A-9017708 |
| Chinese Name | N-丁基乙酰苯胺 |
| Synonyms | N-butylacetoanilide; N-butyl acetylaniline; N-n-butyl acetanilide; MFCD00053789; N-Butyl-acetanilid; EINECS 202-071-5; Caswell No. 124; Butylacetanilide; Acetanilide,N-butyl; Essigsaeure-butylanilid; Acetamide,N-butyl-N-phenyl; N-butyl-N-phenyl-acetamide; N-BUTYLACETANILIDE |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.26900 |
| Purity | 98.00 |
| Density | 0.9303 g/cm3 (16 C) |
| Boiling Point | 273 - 275ºC |
| Melting Point | 215-220 °C (dec.)(lit.) |
| Appearance | Transparent to yellow liquid |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| HTC | 2924299090 |
| SMILES | CCCCN(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO/c1-3-4-10-13(11(2)14)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3 |
| InChI Key | ZWDZJRRQSXLOQR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Aminodiphenyamine-2-sulfonic acid | 91-30-5 | 2A-9017702 |
| 2-[[(3-Amino-4-hydroxyphenyl)sulphonyl]amino]benzoic acid | 91-35-0 | 2A-9017703 |
| 4-Chloro-2-nitro-1-phenoxybenzene | 91-39-4 | 2A-9017704 |
| N-Phenylanthranilic acid | 91-40-7 | 2A-9017705 |
| 1-Chloro-2,5-diethoxy-4-nitrobenzene | 91-43-0 | 2A-9017706 |
| Ethoxyquin | 91-53-2 | 2A-9017710 |
| 2-Chloronaphthalene | 91-58-7 | 2A-9017714 |
| 2-Aminonaphthalene | 91-59-8 | 2A-9017715 |
| 2-Naphthalenethiol | 91-60-1 | 2A-9017716 |
| Quinaldine | 91-63-4 | 2A-9017718 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA