
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 88-50-6 |
| Catalog No. | 2A-9017571 |
| Chinese Name | 2,5-二氯苯胺-4-磺酸 |
| Synonyms | EINECS 201-836-0; 4-Amino-2,5-dichlorobenzenesulfonic acid; MFCD00025159 |
| Molecular Formula | C6H5Cl2NO3S |
| Molecular Weight | 242.082 |
| Purity | 98.00 |
| Density | 1.7±0.1 g/cm3 |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Room temperature, dry |
| Packaging | II |
| HTC | 2921420090 |
| MDL Number | MFCD00025159 |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C6H5Cl2NO3S/c7-3-2-6(13(10,11)12)4(8)1-5(3)9/h1-2H,9H2,(H,10,11,12) |
| InChI Key | SJCTXIKOXTUQHC-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(a) |
| MSDS | msds/17571_1_88_50_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Antioxidant 425 | 88-24-4 | 2A-9017564 |
| 3,5-Di-tert-butyl-4-hydroxybenzyl alcohol | 88-26-6 | 2A-9017565 |
| 2,6-Di-tert-Butyl-4-(dimethylamino)methylphenol | 88-27-7 | 2A-9017566 |
| 2-tert-Butylcyclohexyl acetate | 88-41-5 | 2A-9017568 |
| 2,5-Diaminobenzenesulfonic acid | 88-45-9 | 2A-9017570 |
| 2-Amino-4-chloro-5-methylbenzenesulfonic acid | 88-51-7 | 2A-9017572 |
| 2-Amino-5-chloro-4-methylbenzenesulfonic acid | 88-53-9 | 2A-9017573 |
| 2,5-Di-tert-butylhydroquinone | 88-58-4 | 2A-9017574 |
| 2-Bromobenzoic acid | 88-65-3 | 2A-9017579 |
| 2-Iodobenzoic acid | 88-67-5 | 2A-9017580 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA