![1-[4-[4-(1-Oxopropyl)-1-piperazinyl]-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)benzo[h]-1,6-naphthyridin-2(1H)-one structure, CAS 1222998-36-8](https://www.2abiotech.com/storage/file/20260617/7d5cdef1863ffb9766e032a46502ccd6040a6906.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1222998-36-8 |
| Catalog No. | 2A-1175014 |
| Chinese Name | Torin 1 |
| Synonyms | Torin 1; Torin1 |
| Molecular Formula | C35H28F3N5O2 |
| Molecular Weight | 607.62 |
| Purity | ≥99 (HPLC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 817.2±65.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20℃ |
| Application | Torin 1 is a potent mTOR inhibitor with an IC50 of 3 nM. Torin 1 inhibits the mTORC1/2 complex with IC50 values between 2 and 10 nM. |
| HTC | 29334900 |
| PubChem ID | 103911693 |
| MDL Number | MFCD18782653 |
| SMILES | FC(F)(F)c1c(ccc(c1)[n]3c4c5c(ncc4cc[c]3=O)ccc(c5)c6cnc7c(c6)cccc7)N2CCN(CC2)C(=O)CC |
| InChI | 1S/C35H28F3N5O2/c1-2-32(44)42-15-13-41(14-16-42)31-11-9-26(19-28(31)35(36,37)38)43-33(45)12-8-24-20-40-30-10-7-22(18-27(30)34(24)43)25-17-23-5-3-4-6-29(23)39-21-25/h3-12,17-21H,2,13-16H2,1H3 |
| InChI Key | AKCRNFFTGXBONI-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/175415_1_1222998_36_8.pdf |
| Transport Info | Product Name: Torin 1 |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-3-Aminobutyricacidethylester | 115880-49-4 | 2A-3174991 |
| (R)-3-Amino-5-methylhexanoic acid hydrochloride | 2A-3174992 | 2A-3174992 |
| (3R,4S)-3-amino-4-methylhexanoic acid | 75946-24-6 | 2A-3175003 |
| (3S,4R)-3-amino-4-methylhexanoic acid | 446259-39-8 | 2A-3175009 |
| 6-[7(R)-Hydroxy-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-yl]-N-methyl-2-naphthamide | 752243-39-3 | 2A-1175011 |
| 1-[1-(1-Methylcyclooctyl)-4-piperidinyl]-2-(3R)-3-piperidinyl-1H-benzimidazoletrihydrochloride | 1028969-49-4 | 2A-1175020 |
| Tylosin 3-acetate 4B-(3-methylbutanoate) (2R,3R)-2,3-dihydroxybutanedioate | 63428-13-7 | 2A-2175051 |
| (2R,3R)-3-(2,5-Difluorophenyl)-3-hydroxy-2-Methyl-4-(1H-1,2,4-triazol-1-yl)thiobutyraMide | 368421-58-3 | 2A-2175101 |
| 2-[(8-CHLORO-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEXADECAFLUOROOCTYL)OXY]-1,1,2,2-TETRAFLUOROETHANESULFONYL FLUORIDE | 73606-15-2 | 2A-1175179 |
| TERT-BUTYL 7,8-DIHYDRO-1,6-NAPHTHYRIDINE-6(5H)-CARBOXYLATE | 259809-44-4 | 2A-2175188 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA