
CAS Number24309-97-5
SynonymsN-(2-Hydroxyethyl)acetoacetamid; 1-(2-hydroxy-ethyl)-5-phenyl-pyrimidine-2,4,6-trione; N-(2-Hydroxyethyl)-5-phenyl-barbitursaeure; N-(2-hydroxyethyl)-3-oxobutanamide; N-(2-hydroxy-ethyl)-3-oxo-butyramide; acetoacetic acid monoethanolamide; N-(2-Hydroxyaethyl)-acetessigsaeureamid; N-(-Hydroxy-ethyl)acetoacetamid
Molecular FormulaC6H11NO3
Molecular Weight145.15600
Density1.132 g/cm3
Boiling Point373.7ºC at 760 mmHg
AppearanceYellow to brown solid melt
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24309-97-5 |
| Catalog No. | 2A-1174215 |
| Chinese Name | β-(N-乙酰乙酰氨基)乙醇-d4 |
| Synonyms | N-(2-Hydroxyethyl)acetoacetamid; 1-(2-hydroxy-ethyl)-5-phenyl-pyrimidine-2,4,6-trione; N-(2-Hydroxyethyl)-5-phenyl-barbitursaeure; N-(2-hydroxyethyl)-3-oxobutanamide; N-(2-hydroxy-ethyl)-3-oxo-butyramide; acetoacetic acid monoethanolamide; N-(2-Hydroxyaethyl)-acetessigsaeureamid; N-(-Hydroxy-ethyl)acetoacetamid |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.15600 |
| Density | 1.132 g/cm3 |
| Boiling Point | 373.7ºC at 760 mmHg |
| Appearance | Yellow to brown solid melt |
| Storage Condition | Room temperature, store in inert gas |
| HTC | 2924199090 |
| PubChem ID | 7759840 |
| SMILES | CC(=O)CC(=O)NCCO |
| InChI | InChI=1S/C6H11NO3/c1-5(9)4-6(10)7-2-3-8/h8H,2-4H2,1H3,(H,7,10) |
| InChI Key | CYLHYHWFVOHKMK-UHFFFAOYSA-N |
| MSDS | msds/174555_1_24309_97_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| m-Meconin | 531-88-4 | 2A-1174185 |
| 3-BROMO-2-NITRO-BENZOIC ACID | 116529-61-4 | 2A-1174194 |
| Hexadecanoic acid, 2-hexyldodecyl ester | 134112-34-8 | 2A-1174205 |
| 3-ETHYLHEPTANOIC ACID | 14272-47-0 | 2A-1174209 |
| methyl 2-(1H-indol-2-yl)acetate | 21422-40-2 | 2A-1174214 |
| LFM-A13 | 244240-24-2 | 2A-1174216 |
| Propionic acid 2-hydroxyethyl ester | 24567-27-9 | 2A-1174218 |
| N-(2-Chloro-ethyl)-3-oxo-butyramide | 26244-71-3 | 2A-1174220 |
| 4-(1H-Indol-2-yl)butyric acid | 29873-09-4 | 2A-1174223 |
| 2,2′-(1,4-phenylene)diacetamide | 30038-76-7 | 2A-1174224 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA