
CAS Number21422-40-2
Synonymsmethyl indole-2-acetate; 2-indole methyl acetate; methyl 1H-indole-2-acetate; methyl ester of indole 2-acetic acid; indole-2-acetic acid methyl ester; Methyl 2-indoleacetate; 1H-Indole-2-acetic acid,methyl ester
Molecular FormulaC12H13O2N1
Molecular Weight203.24
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21422-40-2 |
| Catalog No. | 2A-1174214 |
| Chinese Name | 2-(1H-吲哚-2-基)乙酸甲酯 |
| Synonyms | methyl indole-2-acetate; 2-indole methyl acetate; methyl 1H-indole-2-acetate; methyl ester of indole 2-acetic acid; indole-2-acetic acid methyl ester; Methyl 2-indoleacetate; 1H-Indole-2-acetic acid,methyl ester |
| Molecular Formula | C12H13O2N1 |
| Molecular Weight | 203.24 |
| Storage Condition | room temperature |
| PubChem ID | 15983911 |
| MDL Number | MFCD11486692 |
| SMILES | COC(=O)Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H11NO2/c1-14-11(13)7-9-6-8-4-2-3-5-10(8)12-9/h2-6,12H,7H2,1H3 |
| InChI Key | ZXAOWDBYBUEVKE-UHFFFAOYSA-N |
| MSDS | msds/174554_1_21422_40_2.pdf |
| Transport Info | Product name: Methyl 2-(1H-indol-2-yl)acetate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-BROMO-4-METHYL-5-NITROBENZOIC ACID | 34545-20-5 | 2A-1174183 |
| m-Meconin | 531-88-4 | 2A-1174185 |
| 3-BROMO-2-NITRO-BENZOIC ACID | 116529-61-4 | 2A-1174194 |
| Hexadecanoic acid, 2-hexyldodecyl ester | 134112-34-8 | 2A-1174205 |
| 3-ETHYLHEPTANOIC ACID | 14272-47-0 | 2A-1174209 |
| N-(2-hydroxyethyl)acetoacetamide | 24309-97-5 | 2A-1174215 |
| LFM-A13 | 244240-24-2 | 2A-1174216 |
| Propionic acid 2-hydroxyethyl ester | 24567-27-9 | 2A-1174218 |
| N-(2-Chloro-ethyl)-3-oxo-butyramide | 26244-71-3 | 2A-1174220 |
| 4-(1H-Indol-2-yl)butyric acid | 29873-09-4 | 2A-1174223 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA