
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21269-78-3 |
| Catalog No. | 2A-1174078 |
| Chinese Name | (1-乙基-1H-苯并咪唑-2-基)甲醇 |
| Synonyms | 1-Ethyl-2-hydroxymethyl-benzimidazol; 1-ethyl-2-hydroxymethylbenzimidazole; 1-Aethyl-2-hydroxymethyl-benzimidazol; 1h-benzimidazole-2-methanol,1-ethyl |
| Molecular Formula | C10H12O1N2 |
| Molecular Weight | 176.22 |
| Density | 1.18g/cm3 |
| Boiling Point | 357.5ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2933990090 |
| PubChem ID | 3207974 |
| MDL Number | MFCD00964668 |
| SMILES | CCn1c(CO)nc2ccccc21 |
| InChI | InChI=1S/C10H12N2O/c1-2-12-9-6-4-3-5-8(9)11-10(12)7-13/h3-6,13H,2,7H2,1H3 |
| InChI Key | YPMCFIDLEKUBHI-UHFFFAOYSA-N |
| MSDS | msds/174416_1_21269_78_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| O-(2-(p-toluenesulfonyloxy)ethyl)-N-hydroxyphthalimide | 173278-76-7 | 2A-1173570 |
| 2,2,5-TriMethyl-4-phenyl-3-azahexane-3-nitroxide | 61015-94-9 | 2A-1173676 |
| (2,4,6-TrichloropyriMidin-5-yl)Methanol | 1260682-15-2 | 2A-1173903 |
| 1H-Imidazolium, 1-ethenyl-1 (or 3)-methyl-, methyl sulfate, homopolymer | 31855-14-8 | 2A-1174021 |
| PERFLUORO(METHYLCYCLOHEXANE) | 355-02-2 | 2A-1174036 |
| 2-(1H-indol-2-yl)ethanol | 52098-05-2 | 2A-1174106 |
| Siloxanes and Silicones, di-Me, polymers with 3-(2-aminoethyl)aminopropyl silsesquioxanes, hydroxy-terminatedChemicalBook | 68554-54-1 | 2A-1174128 |
| (3-Bromo-2-nitrophenyl)methanol | 1261475-45-9 | 2A-1174202 |
| (2-ethylphenyl)methanol | 767-90-8 | 2A-1174254 |
| 2-Chloro-4-fluoro-6-nitrotoluene | 502496-35-7 | 2A-1174307 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA